6,8-dimethyl-3-(phenylhydrazinylidene)-2,4-dithia-6,8-diazabicyclo[3.2.2]nonane-7,9-dione structure
|
Common Name | 6,8-dimethyl-3-(phenylhydrazinylidene)-2,4-dithia-6,8-diazabicyclo[3.2.2]nonane-7,9-dione | ||
|---|---|---|---|---|
| CAS Number | 81411-29-2 | Molecular Weight | 322.40600 | |
| Density | 1.54g/cm3 | Boiling Point | 595.9ºC at 760 mmHg | |
| Molecular Formula | C13H14N4O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 314.2ºC | |
| Name | 7,9-dimethyl-3-(phenylhydrazinylidene)-2,4-dithia-7,9-diazabicyclo[3.2.2]nonane-6,8-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.54g/cm3 |
|---|---|
| Boiling Point | 595.9ºC at 760 mmHg |
| Molecular Formula | C13H14N4O2S2 |
| Molecular Weight | 322.40600 |
| Flash Point | 314.2ºC |
| Exact Mass | 322.05600 |
| PSA | 115.61000 |
| LogP | 1.38090 |
| Index of Refraction | 1.756 |
| InChIKey | VYVAFSCPCUEYGO-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C2SC(=NNc3ccccc3)SC1C(=O)N2C |
|
~90%
6,8-dimethyl-3-... CAS#:81411-29-2 |
| Literature: Srinivasan; Kolar; Olsen Journal of Heterocyclic Chemistry, 1981 , vol. 18, # 8 p. 1545 - 1548 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 6,8-dimethyl-2,4-dithia-6,8-diaza-7,9-dioxobicyclo<3.2.2>nonane-3-phenylhydrazone |