5-chloro-N-(2-chloro-4-nitrophenyl)salicylamide, compound with piperazine (2:1) structure
|
Common Name | 5-chloro-N-(2-chloro-4-nitrophenyl)salicylamide, compound with piperazine (2:1) | ||
|---|---|---|---|---|
| CAS Number | 81424-66-0 | Molecular Weight | 740.37500 | |
| Density | N/A | Boiling Point | 788.7ºC at 760 mmHg | |
| Molecular Formula | C30H26Cl4N6O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 430.8ºC | |
| Name | 5-chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxybenzamide,piperazine |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 788.7ºC at 760 mmHg |
|---|---|
| Molecular Formula | C30H26Cl4N6O8 |
| Molecular Weight | 740.37500 |
| Flash Point | 430.8ºC |
| Exact Mass | 738.05700 |
| PSA | 221.34000 |
| LogP | 9.37020 |
| InChIKey | POTQQSHAVRUBPV-UHFFFAOYSA-N |
| SMILES | C1CNCCN1.O=C(Nc1ccc([N+](=O)[O-])cc1Cl)c1cc(Cl)ccc1O.O=C(Nc1ccc([N+](=O)[O-])cc1Cl)c1cc(Cl)ccc1O |
| 5-Chloro-N-(2-chloro-4-nitrophenyl)salicylamide,compound with piperazine (2:1) |
| 5-Chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxy-benzamide compound with piperazine (2:1) |
| EINECS 279-760-2 |