[4-[(2-cyanoethyl)ethylamino]phenyl]ethylenetricarbonitrile structure
|
Common Name | [4-[(2-cyanoethyl)ethylamino]phenyl]ethylenetricarbonitrile | ||
|---|---|---|---|---|
| CAS Number | 81430-43-5 | Molecular Weight | 277.32400 | |
| Density | 1.209g/cm3 | Boiling Point | 485.3ºC at 760 mmHg | |
| Molecular Formula | C16H15N5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.9ºC | |
| Name | 2-[4-[2-cyanoethyl(ethyl)amino]phenyl]ethane-1,1,2-tricarbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.209g/cm3 |
|---|---|
| Boiling Point | 485.3ºC at 760 mmHg |
| Molecular Formula | C16H15N5 |
| Molecular Weight | 277.32400 |
| Flash Point | 216.9ºC |
| Exact Mass | 277.13300 |
| PSA | 98.40000 |
| LogP | 2.69712 |
| Index of Refraction | 1.598 |
| InChIKey | KHHSMWZZBJZSIW-UHFFFAOYSA-N |
| SMILES | CCN(CCC#N)c1ccc(C(C#N)C(C#N)C#N)cc1 |
|
~75%
[4-[(2-cyanoeth... CAS#:81430-43-5 |
| Literature: Deligeorgiev, Todor; Lesev, Nedyalko; Kaloyanova, Stefka Dyes and Pigments, 2011 , vol. 91, # 1 p. 74 - 78 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| {4-[Aethyl-(2-cyan-aethyl)-amino]-phenyl}-aethentricarbonitril |
| (4-((2-Cyanoethyl)ethylamino)phenyl)ethylenetricarbonitrile |
| N-Ethyl-N-(2-cyan-ethyl)-4-tricyanvinyl-anilin |
| {4-[ethyl-(2-cyano-ethyl)-amino]-phenyl}-ethenetricarbonitrile |