[4-[[3-(2,2-dimethylpropanoyloxy)-2-oxo-chromen-4-yl]methyl]-2-oxo-chr omen-3-yl] 2,2-dimethylpropanoate structure
|
Common Name | [4-[[3-(2,2-dimethylpropanoyloxy)-2-oxo-chromen-4-yl]methyl]-2-oxo-chr omen-3-yl] 2,2-dimethylpropanoate | ||
|---|---|---|---|---|
| CAS Number | 81456-57-7 | Molecular Weight | 504.52800 | |
| Density | 1.3g/cm3 | Boiling Point | 677.9ºC at 760 mmHg | |
| Molecular Formula | C29H28O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 287.1ºC | |
| Name | [4-[[3-(2,2-dimethylpropanoyloxy)-2-oxochromen-4-yl]methyl]-2-oxochromen-3-yl] 2,2-dimethylpropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 677.9ºC at 760 mmHg |
| Molecular Formula | C29H28O8 |
| Molecular Weight | 504.52800 |
| Flash Point | 287.1ºC |
| Exact Mass | 504.17800 |
| PSA | 113.02000 |
| LogP | 5.39320 |
| Index of Refraction | 1.601 |
| InChIKey | FYURZQZPZYVGQS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)Oc1c(Cc2c(OC(=O)C(C)(C)C)c(=O)oc3ccccc23)c2ccccc2oc1=O |
|
~%
[4-[[3-(2,2-dim... CAS#:81456-57-7 |
| Literature: Stahmann et al. Journal of the American Chemical Society, 1944 , vol. 66, p. 900 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| bis-(2-oxo-4-pivaloyloxy-2H-chromen-3-yl)-methane |
| Propanoic acid,2,2-dimethyl-,methylenebis(2-oxo-2H-1-benzopyran-3,4-diyl) ester |
| methanediylbis(2-oxo-2H-chromene-4,3-diyl) bis(2,2-dimethylpropanoate) |