Naphtho[1,2-d]thiazol-5-ol,2-[(4-methoxyphenyl)amino]-4-methyl-, hydrochloride (1:1) structure
|
Common Name | Naphtho[1,2-d]thiazol-5-ol,2-[(4-methoxyphenyl)amino]-4-methyl-, hydrochloride (1:1) | ||
|---|---|---|---|---|
| CAS Number | 81466-83-3 | Molecular Weight | 372.86800 | |
| Density | 1.372g/cm3 | Boiling Point | 558ºC at 760 mmHg | |
| Molecular Formula | C19H17ClN2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 291.2ºC | |
| Name | 2-(4-methoxyanilino)-4-methylbenzo[e][1,3]benzothiazol-5-ol,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.372g/cm3 |
|---|---|
| Boiling Point | 558ºC at 760 mmHg |
| Molecular Formula | C19H17ClN2O2S |
| Molecular Weight | 372.86800 |
| Flash Point | 291.2ºC |
| Exact Mass | 372.07000 |
| PSA | 82.62000 |
| LogP | 6.09070 |
| Index of Refraction | 1.763 |
| InChIKey | KWCOIIDUTYRUCV-UHFFFAOYSA-N |
| SMILES | COc1ccc(Nc2nc3c(s2)c(C)c(O)c2ccccc23)cc1.Cl |
|
~22%
Naphtho[1,2-d]t... CAS#:81466-83-3 |
| Literature: Ulrich; Cerami Journal of Medicinal Chemistry, 1982 , vol. 25, # 6 p. 654 - 657 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Naphtho(1,2-d)thiazol-5-ol,2-((4-methoxyphenyl)amino)-4-methyl-,monohydrochloride |
| 2-(4-methoxyanilino)-4-methylbenzo[e][1,3]benzothiazol-5-ol hydrochloride |
| 2-[(4-methoxyphenyl)amino]-4-methylnaphtho[1,2-d]thiazol-5-ol monohydrochloride |