3-[4-[(5-Bromopyridin-2-yl)diazenyl]-3-hydroxy-N-propylanilino]propane-1-sulfonic acid structure
|
Common Name | 3-[4-[(5-Bromopyridin-2-yl)diazenyl]-3-hydroxy-N-propylanilino]propane-1-sulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 81608-06-2 | Molecular Weight | 457.34200 | |
| Density | 1.521g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C17H21BrN4O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 3-[4-[(5-Bromopyridin-2-yl)diazenyl]-3-hydroxy-N-propylanilino]propane-1-sulfonic acid5-Br-PAPS is a highly specific Zn2+ metallochromic indicator. 5-Br-PAPS is used in assays for measuring free Zn2+ by forming a deeply colored red Zn2+ complex[1]. |
| Name | 2-[(5-Bromo-2-pyridylazo]-5-[N-propyl-N-(3-sulfopropyl)amino]phenol,disodiumsalt,dihydrate |
|---|
| Description | 5-Br-PAPS is a highly specific Zn2+ metallochromic indicator. 5-Br-PAPS is used in assays for measuring free Zn2+ by forming a deeply colored red Zn2+ complex[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.521g/cm3 |
|---|---|
| Molecular Formula | C17H21BrN4O4S |
| Molecular Weight | 457.34200 |
| Exact Mass | 456.04700 |
| PSA | 123.83000 |
| LogP | 5.54020 |
| Index of Refraction | 1.636 |
| InChIKey | BZRWWAYVITZYRZ-UHFFFAOYSA-N |
| SMILES | CCCN(CCCS(=O)(=O)O)c1ccc(N=Nc2ccc(Br)cn2)c(O)c1 |