Boc-glu(osu)-otbu structure
|
Common Name | Boc-glu(osu)-otbu | ||
|---|---|---|---|---|
| CAS Number | 81659-82-7 | Molecular Weight | 400.42400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H28N2O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Boc-Glu(Osu)-Otbu |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H28N2O8 |
|---|---|
| Molecular Weight | 400.42400 |
| Exact Mass | 400.18500 |
| PSA | 128.31000 |
| LogP | 1.93760 |
| InChIKey | ZZGDWIAZPUAPHR-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)NC(CCC(=O)ON1C(=O)CCC1=O)C(=O)OC(C)(C)C |
|
~80%
Boc-glu(osu)-otbu CAS#:81659-82-7 |
| Literature: Henderson, Graeme B.; Glushka, John; Cowburn, David; Cerami, Anthony Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1990 , # 4 p. 911 - 914 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-O-tert-butyl 5-O-(2,5-dioxopyrrolidin-1-yl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate |