1-methyl-2-oxo-N-phenylpyridine-3-carboxamide structure
|
Common Name | 1-methyl-2-oxo-N-phenylpyridine-3-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 81685-52-1 | Molecular Weight | 228.24700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-methyl-2-oxo-N-phenylpyridine-3-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H12N2O2 |
|---|---|
| Molecular Weight | 228.24700 |
| Exact Mass | 228.09000 |
| PSA | 51.10000 |
| LogP | 1.71060 |
| InChIKey | HWODPCQTFTWIOG-UHFFFAOYSA-N |
| SMILES | Cn1cccc(C(=O)Nc2ccccc2)c1=O |
|
~69%
1-methyl-2-oxo-... CAS#:81685-52-1 |
| Literature: Duong, Thach; Prager, Rolf H.; Were, Stephen T. Australian Journal of Chemistry, 1983 , vol. 36, # 7 p. 1431 - 1440 |
|
~%
1-methyl-2-oxo-... CAS#:81685-52-1 |
| Literature: Duong, Thach; Prager, Rolf H.; Were, Stephen T. Australian Journal of Chemistry, 1983 , vol. 36, # 7 p. 1431 - 1440 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-Pyridinecarboxamide,1,2-dihydro-1-methyl-2-oxo-N-phenyl |
| N-phenyl-1,2-dihydro-1-methyl-2-oxo-3-pyridinecarboxamide |
| 1-methyl-2-oxo-1,2-dihydropyridine-3-carboxanilide |
| N-phenyl dihydro-1,2 methyl-1 oxo-2 pyridine-3 carboxamide |