5-(bromoacetyl)-1,3-phenylene bis(dimethylcarbamate) structure
|
Common Name | 5-(bromoacetyl)-1,3-phenylene bis(dimethylcarbamate) | ||
|---|---|---|---|---|
| CAS Number | 81732-49-2 | Molecular Weight | 373.19900 | |
| Density | 1.453g/cm3 | Boiling Point | 473.528ºC at 760 mmHg | |
| Molecular Formula | C14H17BrN2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 240.181ºC | |
| Name | [3-(2-bromoacetyl)-5-(dimethylcarbamoyloxy)phenyl] N,N-dimethylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.453g/cm3 |
|---|---|
| Boiling Point | 473.528ºC at 760 mmHg |
| Molecular Formula | C14H17BrN2O5 |
| Molecular Weight | 373.19900 |
| Flash Point | 240.181ºC |
| Exact Mass | 372.03200 |
| PSA | 76.15000 |
| LogP | 2.38500 |
| Index of Refraction | 1.563 |
| InChIKey | UIWCLPRSQHCCHA-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)Oc1cc(OC(=O)N(C)C)cc(C(=O)CBr)c1 |
|
~%
5-(bromoacetyl)... CAS#:81732-49-2 |
| Literature: Bosak, Anita; Smilovic, Ivana Gazic; Sinko, Goran; Vinkovic, Vladimir; Kovarik, Zrinka Journal of Medicinal Chemistry, 2012 , vol. 55, # 15 p. 6716 - 6723 |
|
~%
5-(bromoacetyl)... CAS#:81732-49-2 |
| Literature: Asami, Kento; Machida, Takuya; Jung, Sonna; Hanaya, Kengo; Shoji, Mitsuru; Sugai, Takeshi Journal of Molecular Catalysis B: Enzymatic, 2013 , vol. 97, p. 106 - 109 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| EINECS 279-805-6 |
| 2'-bromo-3,5-di(N,N-dimethylcarbamyloxy)acetophenone |
| 5-(Bromoacetyl)-1,3-phenylene bis(dimethylcarbamate) |