chloro-[2-[chloro(dimethyl)stannyl]ethyl]-dimethylstannane structure
|
Common Name | chloro-[2-[chloro(dimethyl)stannyl]ethyl]-dimethylstannane | ||
|---|---|---|---|---|
| CAS Number | 81744-48-1 | Molecular Weight | 396.49900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H16Cl2Sn2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | chloro-[2-[chloro(dimethyl)stannyl]ethyl]-dimethylstannane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H16Cl2Sn2 |
|---|---|
| Molecular Weight | 396.49900 |
| Exact Mass | 397.86700 |
| InChIKey | FWPTXEKJIATJLZ-UHFFFAOYSA-L |
| SMILES | C[Sn](C)(Cl)CC[Sn](C)(C)Cl |
|
~61%
chloro-[2-[chlo... CAS#:81744-48-1 |
| Literature: Andriamizaka, J. D.; Couret, C.; Escudie, J.; Satge, J. Phosphorus and Sulfur and the Related Elements, 1981 , vol. 12, p. 265 - 278 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| bis(dimethylchlorostannyl)-1,2 ethane |
| 1,2-bis(dimethylchlorostannyl) ethane |
| Stannane,1,2-ethanediylbis[chlorodimethyl |