5-[[5-[3-[(Methylamino)methyl]phenyl]-2-thienyl]methyl]-2,4-thiazolidinedione
Modify Date: 2026-07-08 12:31:00
![5-[[5-[3-[(Methylamino)methyl]phenyl]-2-thienyl]methyl]-2,4-thiazolidinedione Structure](https://www.chemsrc.com/extcaspic/039/817618-34-1.png)
5-[[5-[3-[(Methylamino)methyl]phenyl]-2-thienyl]methyl]-2,4-thiazolidinedione structure
|
Common Name | 5-[[5-[3-[(Methylamino)methyl]phenyl]-2-thienyl]methyl]-2,4-thiazolidinedione | ||
|---|---|---|---|---|
| CAS Number | 817618-34-1 | Molecular Weight | 332.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H16N2O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-[[5-[3-[(Methylamino)methyl]phenyl]-2-thienyl]methyl]-2,4-thiazolidinedione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H16N2O2S2 |
|---|---|
| Molecular Weight | 332.4 |
| InChIKey | KLGSFAPXLIJMGG-UHFFFAOYSA-N |
| SMILES | CNCc1cccc(-c2ccc(CC3SC(=O)NC3=O)s2)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 5-[[5-[3-[(Methylamino)methyl]phenyl]-2-thienyl]methyl]-2,4-thiazolidinedione? |
| A: Molecular formula of 5-[[5-[3-[(Methylamino)methyl]phenyl]-2-thienyl]methyl]-2,4-thiazolidinedione is C16H16N2O2S2. |
| Q: What is the molecular weight of 5-[[5-[3-[(Methylamino)methyl]phenyl]-2-thienyl]methyl]-2,4-thiazolidinedione? |
| A: Molecular weight of 5-[[5-[3-[(Methylamino)methyl]phenyl]-2-thienyl]methyl]-2,4-thiazolidinedione is 332.4. |
| Q: What is the InChIKey of 5-[[5-[3-[(Methylamino)methyl]phenyl]-2-thienyl]methyl]-2,4-thiazolidinedione? |
| A: InChIKey of 5-[[5-[3-[(Methylamino)methyl]phenyl]-2-thienyl]methyl]-2,4-thiazolidinedione is KLGSFAPXLIJMGG-UHFFFAOYSA-N. |
| Q: What is the CAS number of 5-[[5-[3-[(Methylamino)methyl]phenyl]-2-thienyl]methyl]-2,4-thiazolidinedione? |
| A: CAS number of 5-[[5-[3-[(Methylamino)methyl]phenyl]-2-thienyl]methyl]-2,4-thiazolidinedione is 817618-34-1. |
| Q: What is the English name of 5-[[5-[3-[(Methylamino)methyl]phenyl]-2-thienyl]methyl]-2,4-thiazolidinedione? |
| A: The English name of 5-[[5-[3-[(Methylamino)methyl]phenyl]-2-thienyl]methyl]-2,4-thiazolidinedione is 5-[[5-[3-[(Methylamino)methyl]phenyl]-2-thienyl]methyl]-2,4-thiazolidinedione. |
| Q: What is the SMILES notation of 5-[[5-[3-[(Methylamino)methyl]phenyl]-2-thienyl]methyl]-2,4-thiazolidinedione? |
| A: SMILES notation of 5-[[5-[3-[(Methylamino)methyl]phenyl]-2-thienyl]methyl]-2,4-thiazolidinedione is CNCc1cccc(-c2ccc(CC3SC(=O)NC3=O)s2)c1. |
| Q: What is the Chinese name of 817618-34-1? |
| A: Chinese name of 817618-34-1 is 817618-34-1. |