(4-chlorophenyl)-(2-sulfanylphenyl)methanone structure
|
Common Name | (4-chlorophenyl)-(2-sulfanylphenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 817622-04-1 | Molecular Weight | 248.72800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H9ClOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-chlorophenyl)-(2-sulfanylphenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H9ClOS |
|---|---|
| Molecular Weight | 248.72800 |
| Exact Mass | 248.00600 |
| PSA | 55.87000 |
| LogP | 3.85970 |
| InChIKey | CXQBROXUWHNJFQ-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(Cl)cc1)c1ccccc1S |
|
~%
(4-chlorophenyl... CAS#:817622-04-1 |
| Literature: Kobayashi, Kazuhiro; Umakoshi, Hironobu; Matsunaga, Akihiro; Tanmatsu, Miyuki; Morikawa, Osamu; Konishi, Hisatoshi Bulletin of the Chemical Society of Japan, 2004 , vol. 77, # 11 p. 2095 - 2096 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| (4-chlorophenyl)(2-mercaptophenyl)methanone |
| 4-chlorphenyl(2-mercaptophenyl)methanone |
| 4'-chloro-2-mercaptobenzophenone |
| Methanone,(4-chlorophenyl)(2-mercaptophenyl) |