sr23 structure
|
Common Name | sr23 | ||
|---|---|---|---|---|
| CAS Number | 81809-83-8 | Molecular Weight | 228.20700 | |
| Density | 1.53g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H8N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | sr23 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.53g/cm3 |
|---|---|
| Molecular Formula | C11H8N4O2 |
| Molecular Weight | 228.20700 |
| Exact Mass | 228.06500 |
| PSA | 76.01000 |
| LogP | 2.62230 |
| Index of Refraction | 1.757 |
| InChIKey | PQXGNCKIHVYXBW-UHFFFAOYSA-N |
| SMILES | Cc1c([N+](=O)[O-])cnc2c1nc1ccccn12 |
|
~68%
sr23 CAS#:81809-83-8 |
| Literature: Saint-Ruf; Loukakou; Zouzi Journal of Heterocyclic Chemistry, 1981 , vol. 18, # 8 p. 1565 - 1570 |
|
~%
sr23 CAS#:81809-83-8 |
| Literature: Saint-Ruf; Loukakou; Zouzi Journal of Heterocyclic Chemistry, 1981 , vol. 18, # 8 p. 1565 - 1570 |
| Precursor 2 | |
|---|---|
| DownStream 2 | |
| Dipyrido(1,2-a:3',2'-d)imidazole,4-methyl-3-nitro |
| 4-methyl-3-nitrodipyrido<1,2-a:3',2'-d>imidazole |