5,6,7,13-tetrahydro-9,10-dimethoxy-2,3-methylenedioxybenzindeno<1,2-b>azepin-13-one structure
|
Common Name | 5,6,7,13-tetrahydro-9,10-dimethoxy-2,3-methylenedioxybenzindeno<1,2-b>azepin-13-one | ||
|---|---|---|---|---|
| CAS Number | 81816-05-9 | Molecular Weight | 351.35300 | |
| Density | 1.44g/cm3 | Boiling Point | 617.2ºC at 760 mmHg | |
| Molecular Formula | C20H17NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 327.1ºC | |
| Name | 5,6,7,13-tetrahydro-9,10-dimethoxy-2,3-methylenedioxybenzindeno<1,2-b>azepin-13-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.44g/cm3 |
|---|---|
| Boiling Point | 617.2ºC at 760 mmHg |
| Molecular Formula | C20H17NO5 |
| Molecular Weight | 351.35300 |
| Flash Point | 327.1ºC |
| Exact Mass | 351.11100 |
| PSA | 66.02000 |
| LogP | 2.97160 |
| Index of Refraction | 1.683 |
| InChIKey | MKHRAWDXJGOQHG-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1OC)C1=C(C2=O)c2cc3c(cc2CCN1)OCO3 |
|
~97%
5,6,7,13-tetrah... CAS#:81816-05-9 |
| Literature: Hanaoka; Inoue; Sakurai; et al. Chemical and Pharmaceutical Bulletin, 1982 , vol. 30, # 3 p. 1110 - 1112 |
|
~41%
5,6,7,13-tetrah... CAS#:81816-05-9 |
| Literature: Hanaoka; Kim; Inoue; Nagami; Shimada; Yasuda Chemical and pharmaceutical bulletin, 1985 , vol. 33, # 4 p. 1434 - 1443 |
|
~%
5,6,7,13-tetrah... CAS#:81816-05-9 |
| Literature: Hanaoka; Kim; Inoue; Nagami; Shimada; Yasuda Chemical and pharmaceutical bulletin, 1985 , vol. 33, # 4 p. 1434 - 1443 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 5,6,7,13-tetrahydro-9,10-dimethoxy-2,3-methylenedioxybenz[d]indeno[1,2-b]azepin-13-one |