1-(4-methoxyphenyl)sulfonylindole-3-carbaldehyde
Modify Date: 2025-08-21 10:41:51
1-(4-methoxyphenyl)sulfonylindole-3-carbaldehyde structure
|
Common Name | 1-(4-methoxyphenyl)sulfonylindole-3-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 81816-15-1 | Molecular Weight | 315.34400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H13NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-methoxyphenyl)sulfonylindole-3-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H13NO4S |
|---|---|
| Molecular Weight | 315.34400 |
| Exact Mass | 315.05700 |
| PSA | 73.75000 |
| LogP | 3.78020 |
| InChIKey | UYWORRZVTQKAFK-UHFFFAOYSA-N |
| SMILES | COc1ccc(S(=O)(=O)n2cc(C=O)c3ccccc32)cc1 |
|
~89%
1-(4-methoxyphe... CAS#:81816-15-1 |
| Literature: Coowar, Djalil; Bouissac, Julien; Hanbali, Mazen; Paschaki, Marie; Mohier, Eliane; Luu, Bang Journal of Medicinal Chemistry, 2004 , vol. 47, # 25 p. 6270 - 6282 |
|
~%
1-(4-methoxyphe... CAS#:81816-15-1 |
| Literature: Coowar, Djalil; Bouissac, Julien; Hanbali, Mazen; Paschaki, Marie; Mohier, Eliane; Luu, Bang Journal of Medicinal Chemistry, 2004 , vol. 47, # 25 p. 6270 - 6282 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| N-(4-methoxybenzenesulfonyl)indole-3-carboxaldehyde |
| 1-(4-methoxybenzenesulfonyl)-1H-indole-3-carboxaldehyde |
| 1-(4-Methoxybenzenesulfonyl)-1H-indole-3-carbaldehyde |
| 1H-Indole-3-carboxaldehyde,1-[(4-methoxyphenyl)sulfonyl] |
| 1-[(4-methoxyphenyl)sulfonyl]indole-3-carbaldehyde |