2-(4-methoxyphenyl)-4-methylsulfanyl-6-phenylpyridine structure
|
Common Name | 2-(4-methoxyphenyl)-4-methylsulfanyl-6-phenylpyridine | ||
|---|---|---|---|---|
| CAS Number | 81874-68-2 | Molecular Weight | 307.40900 | |
| Density | 1.2g/cm3 | Boiling Point | 469.5ºC at 760 mmHg | |
| Molecular Formula | C19H17NOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 237.7ºC | |
| Name | 2-(4-methoxyphenyl)-4-methylsulfanyl-6-phenylpyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 469.5ºC at 760 mmHg |
| Molecular Formula | C19H17NOS |
| Molecular Weight | 307.40900 |
| Flash Point | 237.7ºC |
| Exact Mass | 307.10300 |
| PSA | 47.42000 |
| LogP | 5.14610 |
| Index of Refraction | 1.65 |
| InChIKey | CHAUWSCGUXHRCI-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2cc(SC)cc(-c3ccccc3)n2)cc1 |
|
~79%
2-(4-methoxyphe... CAS#:81874-68-2 |
| Literature: Potts, Kevin T.; Cipullo, Michael J.; Ralli, Philip; Theodoridis, George Journal of Organic Chemistry, 1982 , vol. 47, # 16 p. 3027 - 3038 |
| Pyridine,2-(4-methoxyphenyl)-4-(methylthio)-6-phenyl |