1-(3,4-dimethoxyphenyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]propan-2-amine structure
|
Common Name | 1-(3,4-dimethoxyphenyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]propan-2-amine | ||
|---|---|---|---|---|
| CAS Number | 81877-58-9 | Molecular Weight | 395.92000 | |
| Density | 1.064g/cm3 | Boiling Point | 479.7ºC at 760 mmHg | |
| Molecular Formula | C21H30ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.1ºC | |
| Name | 1-(3,4-dimethoxyphenyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]propan-2-amine,hydrochloride |
|---|
| Density | 1.064g/cm3 |
|---|---|
| Boiling Point | 479.7ºC at 760 mmHg |
| Molecular Formula | C21H30ClNO4 |
| Molecular Weight | 395.92000 |
| Flash Point | 209.1ºC |
| Exact Mass | 395.18600 |
| PSA | 48.95000 |
| LogP | 4.67720 |
| Index of Refraction | 1.53 |
| InChIKey | BBGABIHSYUXBPW-UHFFFAOYSA-N |
| SMILES | COc1ccc(CCNC(C)Cc2ccc(OC)c(OC)c2)cc1OC.Cl |
|
~60%
1-(3,4-dimethox... CAS#:81877-58-9 |
| Literature: Stout, David M.; Gorczynski, Richard J. Journal of Medicinal Chemistry, 1982 , vol. 25, # 3 p. 326 - 328 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |