trans-2-hydroxy-3,3,5,5-tetramethylcyclopentane-1-carboxylic acid
Modify Date: 2026-09-15 17:29:11
trans-2-hydroxy-3,3,5,5-tetramethylcyclopentane-1-carboxylic acid structure
|
Common Name | trans-2-hydroxy-3,3,5,5-tetramethylcyclopentane-1-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 81887-90-3 | Molecular Weight | 186.24800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | trans-2-hydroxy-3,3,5,5-tetramethylcyclopentane-1-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H18O3 |
|---|---|
| Molecular Weight | 186.24800 |
| Exact Mass | 186.12600 |
| PSA | 57.53000 |
| LogP | 1.50420 |
| InChIKey | JFZGZHIIGFKTQC-UHFFFAOYSA-N |
| SMILES | CC1(C)CC(C)(C)C(C(=O)O)C1O |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Hydroxy-3,3,5,5-tetramethylcyclopentanecarboxylic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of trans-2-hydroxy-3,3,5,5-tetramethylcyclopentane-1-carboxylic acid? |
| A: The English name of trans-2-hydroxy-3,3,5,5-tetramethylcyclopentane-1-carboxylic acid is trans-2-hydroxy-3,3,5,5-tetramethylcyclopentane-1-carboxylic acid. |
| Q: What is the Chinese name of 81887-90-3? |
| A: Chinese name of 81887-90-3 is 81887-90-3. |
| Q: What is the molecular formula of trans-2-hydroxy-3,3,5,5-tetramethylcyclopentane-1-carboxylic acid? |
| A: Molecular formula of trans-2-hydroxy-3,3,5,5-tetramethylcyclopentane-1-carboxylic acid is C10H18O3. |
| Q: What is the InChIKey of trans-2-hydroxy-3,3,5,5-tetramethylcyclopentane-1-carboxylic acid? |
| A: InChIKey of trans-2-hydroxy-3,3,5,5-tetramethylcyclopentane-1-carboxylic acid is JFZGZHIIGFKTQC-UHFFFAOYSA-N. |
| Q: What English synonyms does trans-2-hydroxy-3,3,5,5-tetramethylcyclopentane-1-carboxylic acid have? |
| A: English synonyms of trans-2-hydroxy-3,3,5,5-tetramethylcyclopentane-1-carboxylic acid: 2-Hydroxy-3,3,5,5-tetramethylcyclopentanecarboxylic acid. |
| Q: What is the SMILES notation of trans-2-hydroxy-3,3,5,5-tetramethylcyclopentane-1-carboxylic acid? |
| A: SMILES notation of trans-2-hydroxy-3,3,5,5-tetramethylcyclopentane-1-carboxylic acid is CC1(C)CC(C)(C)C(C(=O)O)C1O. |
| Q: What is the molecular weight of trans-2-hydroxy-3,3,5,5-tetramethylcyclopentane-1-carboxylic acid? |
| A: Molecular weight of trans-2-hydroxy-3,3,5,5-tetramethylcyclopentane-1-carboxylic acid is 186.24800. |
| Q: What is the CAS number of trans-2-hydroxy-3,3,5,5-tetramethylcyclopentane-1-carboxylic acid? |
| A: CAS number of trans-2-hydroxy-3,3,5,5-tetramethylcyclopentane-1-carboxylic acid is 81887-90-3. |
| Q: What is the polar surface area (PSA) of trans-2-hydroxy-3,3,5,5-tetramethylcyclopentane-1-carboxylic acid? |
| A: Polar surface area (PSA) of trans-2-hydroxy-3,3,5,5-tetramethylcyclopentane-1-carboxylic acid is 57.53000. |
| Q: What is the LogP of trans-2-hydroxy-3,3,5,5-tetramethylcyclopentane-1-carboxylic acid? |
| A: LogP of trans-2-hydroxy-3,3,5,5-tetramethylcyclopentane-1-carboxylic acid is 1.50420. |