trimethyl 4-hydroxybenzene-1,2,3-tricarboxylate
Modify Date: 2025-08-25 18:40:43
trimethyl 4-hydroxybenzene-1,2,3-tricarboxylate structure
|
Common Name | trimethyl 4-hydroxybenzene-1,2,3-tricarboxylate | ||
|---|---|---|---|---|
| CAS Number | 81931-48-8 | Molecular Weight | 268.21900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trimethyl 4-hydroxybenzene-1,2,3-tricarboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H12O7 |
|---|---|
| Molecular Weight | 268.21900 |
| Exact Mass | 268.05800 |
| PSA | 99.13000 |
| LogP | 0.75200 |
| InChIKey | RLAQYWQGVIWVHJ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(O)c(C(=O)OC)c1C(=O)OC |
|
~%
trimethyl 4-hyd... CAS#:81931-48-8 |
| Literature: Buehler; Spees; Sanguinetti Journal of the American Chemical Society, 1949 , vol. 71, p. 11 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-Hydroxy-benzol-1,2,3-tricarbonsaeure-trimethylester |
| 1,2,3-Benzenetricarboxylic acid,4-hydroxy-,trimethyl ester |
| 4-hydroxy-benzene-1,2,3-tricarboxylic acid trimethyl ester |