Lancerin structure
|
Common Name | Lancerin | ||
|---|---|---|---|---|
| CAS Number | 81991-99-3 | Molecular Weight | 406.340 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 770.2±60.0 °C at 760 mmHg | |
| Molecular Formula | C19H18O10 | Melting Point | 225-227 °C | |
| MSDS | N/A | Flash Point | 279.3±26.4 °C | |
Use of LancerinLancerin, isolated from the root bark of Cudraniu cochinchinensis, possesses anti-lipid peroxidation[1]. |
| Name | lancerin |
|---|---|
| Synonym | More Synonyms |
| Description | Lancerin, isolated from the root bark of Cudraniu cochinchinensis, possesses anti-lipid peroxidation[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 770.2±60.0 °C at 760 mmHg |
| Melting Point | 225-227 °C |
| Molecular Formula | C19H18O10 |
| Molecular Weight | 406.340 |
| Flash Point | 279.3±26.4 °C |
| Exact Mass | 406.089996 |
| PSA | 181.05000 |
| LogP | 0.55 |
| Vapour Pressure | 0.0±2.8 mmHg at 25°C |
| Index of Refraction | 1.761 |
| InChIKey | JUZGXATTXYZBGK-HBVDJMOISA-N |
| SMILES | O=c1c2cc(O)ccc2oc2c(C3OC(CO)C(O)C(O)C3O)c(O)cc(O)c12 |
| (1S)-1,5-Anhydro-1-(1,3,7-trihydroxy-9-oxo-9H-xanthen-4-yl)-D-glucitol |
| Lancerin |
| 4-C-Glucosyl-1,3,7-trihydroxyxanthone |
| D-Glucitol, 1,5-anhydro-1-C-(1,3,7-trihydroxy-9-oxo-9H-xanthen-4-yl)-, (1S)- |
| 1,3,7-trihydroxy-4-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]xanthen-9-one |
| 4-beta-D-Glucopyranosyl-1,3,7-trihydroxy-9H-xanthen-9-one |