a-Toxicarol structure
|
Common Name | a-Toxicarol | ||
|---|---|---|---|---|
| CAS Number | 82-09-7 | Molecular Weight | 410.42 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 607.2±55.0 °C at 760 mmHg | |
| Molecular Formula | C23H22O7 | Melting Point | 222℃ | |
| MSDS | N/A | Flash Point | 213.0±25.0 °C | |
Use of a-Toxicarolα-Toxicarol is a potent inhibitor of EBV.α-Toxicarol significantly inhibits mouse skin tumor in vivo. α-Toxicarol inhibits the TPA-induced EBV-EA activation[1]. |
| Name | α-Toxicarol |
|---|---|
| Synonym | More Synonyms |
| Description | α-Toxicarol is a potent inhibitor of EBV.α-Toxicarol significantly inhibits mouse skin tumor in vivo. α-Toxicarol inhibits the TPA-induced EBV-EA activation[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 607.2±55.0 °C at 760 mmHg |
| Melting Point | 222℃ |
| Molecular Formula | C23H22O7 |
| Molecular Weight | 410.42 |
| Flash Point | 213.0±25.0 °C |
| Exact Mass | 410.136566 |
| PSA | 83.45000 |
| LogP | 6.06 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.600 |
| InChIKey | JLTNCZQNGBLBGO-MRTLOADZSA-N |
| SMILES | COc1cc2c(cc1OC)C1C(=O)c3c(O)cc4c(c3OC1CO2)C=CC(C)(C)O4 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| 3H-Bis(1)benzopyrano(3,4-b:6',5'-e)pyran-7(7aH)-one, 13,13a-dihydro-6-hydroxy-9,10-dimethoxy-3,3-dimethyl-, (7aS-cis)- |
| (7aS,13aS)-6-Hydroxy-9,10-dimethoxy-3,3-dimethyl-13,13a-dihydro-3H-chromeno[3,4-b]pyrano[2,3-h]chromen-7(7aH)-one |
| 3H-[1]Benzopyrano[3,4-b]pyrano[2,3-h][1]benzopyran-7(7aH)-one, 13,13a-dihydro-6-hydroxy-9,10-dimethoxy-3,3-dimethyl-, (7aS,13aS)- |
| a-Toxicarol |
| (7aS-cis)-13,13a-Dihydro-6-hydroxy-9,10-dimethoxy-3,3-dimethyl-3H-bis(1)benzopyrano[3,4-b:6',5'-e]pyran-7(7aH)-one |