8-chloro-1-naphthalenesulfonyl chloride(SALTDATA: FREE) structure
|
Common Name | 8-chloro-1-naphthalenesulfonyl chloride(SALTDATA: FREE) | ||
|---|---|---|---|---|
| CAS Number | 82-74-6 | Molecular Weight | 261.12400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H6Cl2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 8-chloronaphthalene-1-sulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H6Cl2O2S |
|---|---|
| Molecular Weight | 261.12400 |
| Exact Mass | 259.94700 |
| PSA | 42.52000 |
| LogP | 4.50150 |
| InChIKey | WORJISAOMPPPTM-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cl)c1cccc2cccc(Cl)c12 |
| HS Code | 2904909090 |
|---|
|
~%
8-chloro-1-naph... CAS#:82-74-6 |
| Literature: Rohm and Haas Company Patent: US5272128 A1, 1993 ; |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 8-Chlor-1-naphthylsulfonylchlorid |
| 8-Chlor-naphthalinsulfonylchlorid |
| 1-Chlor-naphthalin-8-sulfochlorid |
| 1-Naphthalenesulfonyl chloride,8-chloro |
| 8-Chlor-naphthalin-1-sulfonylchlorid |
| 8-chloro-naphthalene-1-sulfonyl chloride |
| 8-chloro-1-naphthalenesulfonyl chloride |