4-[(4-Amino-3-methylphenyl)- phenylmethyl]-2-methylaniline structure
|
Common Name | 4-[(4-Amino-3-methylphenyl)- phenylmethyl]-2-methylaniline | ||
|---|---|---|---|---|
| CAS Number | 82-87-1 | Molecular Weight | 302.413 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 492.0±40.0 °C at 760 mmHg | |
| Molecular Formula | C21H22N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 302.1±26.8 °C | |
| Name | 4-[(4-amino-3-methylphenyl)-phenylmethyl]-2-methylaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 492.0±40.0 °C at 760 mmHg |
| Molecular Formula | C21H22N2 |
| Molecular Weight | 302.413 |
| Flash Point | 302.1±26.8 °C |
| Exact Mass | 302.178314 |
| PSA | 52.04000 |
| LogP | 4.05 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.647 |
| InChIKey | FANQUUGICQRGJV-UHFFFAOYSA-N |
| SMILES | Cc1cc(C(c2ccccc2)c2ccc(N)c(C)c2)ccc1N |
| HS Code | 2921590090 |
|---|
|
~%
4-[(4-Amino-3-m... CAS#:82-87-1 |
| Literature: Vongerichten; Weilinger Zeitschrift fuer Farben-und Textil-Chemie, vol. 3, p. 217 Chem. Zentralbl., 1904 , vol. 75, # II p. 226 |
|
~%
4-[(4-Amino-3-m... CAS#:82-87-1 |
| Literature: Ullmann,C. Journal fuer Praktische Chemie (Leipzig), 1887 , vol. <2> 36, p. 265 |
|
~%
4-[(4-Amino-3-m... CAS#:82-87-1 |
| Literature: Ullmann,C. Journal fuer Praktische Chemie (Leipzig), 1887 , vol. <2> 36, p. 265 |
|
~%
4-[(4-Amino-3-m... CAS#:82-87-1 |
| Literature: Vongerichten; Weilinger Chem. Zentralbl., 1904 , vol. 75, # II p. 226 |
| HS Code | 2921590090 |
|---|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| EINECS 201-442-9 |
| Benzenamine,4,4'-(phenylmethylene)bis(2-methyl |
| 4.4'-Diamino-3.3'-dimethyl-triphenylmethan |
| 3,3'-dimethyl-4,4'-diaminotriphenylmethane |
| Benzenamine, 4,4'-(phenylmethylene)bis[2-methyl- |
| 4,4'-Benzylidenedi-o-toluidine |
| bis-(4-amino-3-methyl-phenyl)-phenyl-methane |
| 4,4'-(Phenylmethylene)bis(2-methylaniline) |