5-methoxy-4-(3-methoxyphenyl)-3H-benzo[f][2]benzofuran-1-one structure
|
Common Name | 5-methoxy-4-(3-methoxyphenyl)-3H-benzo[f][2]benzofuran-1-one | ||
|---|---|---|---|---|
| CAS Number | 82001-20-5 | Molecular Weight | 320.33900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-methoxy-4-(3-methoxyphenyl)-3H-benzo[f][2]benzofuran-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H16O4 |
|---|---|
| Molecular Weight | 320.33900 |
| Exact Mass | 320.10500 |
| PSA | 44.76000 |
| LogP | 4.19440 |
| InChIKey | VZHGMDPUILOXMS-UHFFFAOYSA-N |
| SMILES | COc1cccc(-c2c3c(cc4cccc(OC)c24)C(=O)OC3)c1 |
|
~34%
5-methoxy-4-(3-... CAS#:82001-20-5 |
| Literature: Pelter, Andrew; Ward, Robert S.; Satyanarayana, Panchagnula; Collins, Peter Tetrahedron Letters, 1982 , vol. 23, # 5 p. 571 - 572 |
|
~%
5-methoxy-4-(3-... CAS#:82001-20-5 |
| Literature: Pelter, Andrew; Ward, Robert S.; Satyanarayana, Panchagnula; Collins, Peter Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , p. 643 - 647 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Naphtho[2,3-c]furan-1(3H)-one,5-methoxy-4-(3-methoxyphenyl) |