pertilide structure
|
Common Name | pertilide | ||
|---|---|---|---|---|
| CAS Number | 82003-39-2 | Molecular Weight | 260.28500 | |
| Density | 1.24g/cm3 | Boiling Point | 532ºC at 760 mmHg | |
| Molecular Formula | C15H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 284.9ºC | |
| Name | pertilide |
|---|
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 532ºC at 760 mmHg |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.28500 |
| Flash Point | 284.9ºC |
| Exact Mass | 260.10500 |
| PSA | 52.60000 |
| LogP | 2.06620 |
| Index of Refraction | 1.562 |
| InChIKey | AESSLYMIMCLSHB-BAQGIRSFSA-N |
| SMILES | C=C1C(=O)OC2CC3=CCC(OC3=O)C(C)=CCC12 |
|
~%
pertilide CAS#:82003-39-2 |
| Literature: Nagumo, Seiji; Nagai, Masahiro; Inoue, Takao Chemical and Pharmaceutical Bulletin, 1983 , vol. 31, # 7 p. 2302 - 2307 |
|
~%
pertilide CAS#:82003-39-2 |
| Literature: Nagumo, Seiji; Nagai, Masahiro; Inoue, Takao Chemical and Pharmaceutical Bulletin, 1983 , vol. 31, # 7 p. 2302 - 2307 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |