trimethyl-[3-(1-trimethylstannylethenyl)hept-1-ynyl]silane structure
|
Common Name | trimethyl-[3-(1-trimethylstannylethenyl)hept-1-ynyl]silane | ||
|---|---|---|---|---|
| CAS Number | 820250-80-4 | Molecular Weight | 357.18500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H30SiSn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trimethyl-[3-(1-trimethylstannylethenyl)hept-1-ynyl]silane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H30SiSn |
|---|---|
| Molecular Weight | 357.18500 |
| Exact Mass | 358.11400 |
| LogP | 4.63290 |
| InChIKey | IDEXXHGOSJLLLL-UHFFFAOYSA-N |
| SMILES | C=C(C(C#C[Si](C)(C)C)CCCC)[Sn](C)(C)C |
|
~%
trimethyl-[3-(1... CAS#:820250-80-4 |
| Literature: Shirakawa, Eiji; Hiyama, Tamejiro Bulletin of the Chemical Society of Japan, 2002 , vol. 75, # 7 p. 1435 - 1450 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-butyl-5-trimethylsilyl-2-trimethylstannyl-1-penten-4-yne |
| Silane,trimethyl[3-[1-(trimethylstannyl)ethenyl]-1-heptynyl] |