8,11a-Methano-11aH-cyclohepta[a]naphthalene-4,9-dimethanol,tetradecahydro-3,9-dihydroxy-4,11b-dimethyl-, a4-acetate, [3R-(3a,4a,4aa,6ab,8b,9b,11ab,11bb)]- (9CI) structure
|
Common Name | 8,11a-Methano-11aH-cyclohepta[a]naphthalene-4,9-dimethanol,tetradecahydro-3,9-dihydroxy-4,11b-dimethyl-, a4-acetate, [3R-(3a,4a,4aa,6ab,8b,9b,11ab,11bb)]- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 82026-03-7 | Molecular Weight | 380.51800 | |
| Density | 1.21g/cm3 | Boiling Point | 513ºC at 760 mmHg | |
| Molecular Formula | C22H36O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.8ºC | |
| Name | aphidicolin, 18-acetoxy |
|---|
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 513ºC at 760 mmHg |
| Molecular Formula | C22H36O5 |
| Molecular Weight | 380.51800 |
| Flash Point | 171.8ºC |
| Exact Mass | 380.25600 |
| PSA | 86.99000 |
| LogP | 2.65660 |
| Index of Refraction | 1.564 |
| InChIKey | SSEWIUPYEWEJEH-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC1(C)C(O)CCC2(C)C1CCC1CC3CC12CCC3(O)CO |
|
~%
8,11a-Methano-1... CAS#:82026-03-7 |
| Literature: Ipsen, John; Fuska, Jan; Foskova, A.; Rosazza, John P. Journal of Organic Chemistry, 1982 , vol. 47, # 17 p. 3278 - 3282 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |