6-.beta.-Hydroxyaphidicolin structure
|
Common Name | 6-.beta.-Hydroxyaphidicolin | ||
|---|---|---|---|---|
| CAS Number | 82026-07-1 | Molecular Weight | 354.48100 | |
| Density | 1.29g/cm3 | Boiling Point | 549.3ºC at 760 mmHg | |
| Molecular Formula | C20H34O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 250.6ºC | |
| Name | 6-.β.-Hydroxyaphidicolin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 549.3ºC at 760 mmHg |
| Molecular Formula | C20H34O5 |
| Molecular Weight | 354.48100 |
| Flash Point | 250.6ºC |
| Exact Mass | 354.24100 |
| PSA | 101.15000 |
| LogP | 1.05660 |
| Index of Refraction | 1.602 |
| InChIKey | SOPHJADXFALVLH-UHFFFAOYSA-N |
| SMILES | CC1(CO)C(O)CCC2(C)C1C(O)CC1CC3CC12CCC3(O)CO |
|
~%
6-.beta.-Hydrox... CAS#:82026-07-1 |
| Literature: Ipsen, John; Fuska, Jan; Foskova, A.; Rosazza, John P. Journal of Organic Chemistry, 1982 , vol. 47, # 17 p. 3278 - 3282 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| n-benzo[1,3]dioxol-5-yl-2-(2-bromo-4-methyl-phenoxy)acetamide |