2-(4-diphenylphosphorylbut-2-en-2-yl)-4-methoxy-5-methyl-benzoic acid structure
|
Common Name | 2-(4-diphenylphosphorylbut-2-en-2-yl)-4-methoxy-5-methyl-benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 82045-53-2 | Molecular Weight | 420.43700 | |
| Density | 1.23g/cm3 | Boiling Point | 574.6ºC at 760 mmHg | |
| Molecular Formula | C25H25O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 301.3ºC | |
| Name | 2-[(Z)-4-diphenylphosphorylbut-2-en-2-yl]-4-methoxy-5-methylbenzoic acid |
|---|
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 574.6ºC at 760 mmHg |
| Molecular Formula | C25H25O4P |
| Molecular Weight | 420.43700 |
| Flash Point | 301.3ºC |
| Exact Mass | 420.14900 |
| PSA | 73.41000 |
| LogP | 5.11920 |
| Index of Refraction | 1.609 |
| InChIKey | LJDMTIOWAVMTTR-JXAWBTAJSA-N |
| SMILES | COc1cc(C(C)=CCP(=O)(c2ccccc2)c2ccccc2)c(C(=O)O)cc1C |
|
~%
2-(4-diphenylph... CAS#:82045-53-2 |
| Literature: Smith, Amos B.; Schow, Steven R.; Bloom, Jonathan D.; Thompson, Andrew S.; Winzenberg, Kevin N. Journal of the American Chemical Society, 1982 , vol. 104, # 14 p. 4015 - 4018 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |