1-trimethylsilyloxycyclohex-2-ene-1-carbonitrile structure
|
Common Name | 1-trimethylsilyloxycyclohex-2-ene-1-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 82053-13-2 | Molecular Weight | 195.33400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H17NOSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-trimethylsilyloxycyclohex-2-ene-1-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H17NOSi |
|---|---|
| Molecular Weight | 195.33400 |
| Exact Mass | 195.10800 |
| PSA | 33.02000 |
| LogP | 2.84038 |
| InChIKey | QSNRHVZQROCGTP-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)OC1(C#N)C=CCCC1 |
|
~99%
1-trimethylsily... CAS#:82053-13-2 |
| Literature: Fetterly, Brandon M.; Verkade, John G. Tetrahedron Letters, 2005 , vol. 46, # 46 p. 8061 - 8066 |
|
~75%
1-trimethylsily... CAS#:82053-13-2 |
| Literature: Noyori, R.; Murata, S.; Suzuki, M. Tetrahedron, 1981 , vol. 37, # 23 p. 3899 - 3910 |
|
~88%
1-trimethylsily... CAS#:82053-13-2 |
| Literature: Higuchi, Katsumi; Onaka, Makoto; Izumi, Yusuke Bulletin of the Chemical Society of Japan, 1993 , vol. 66, # 7 p. 2016 - 2032 |
|
~0%
1-trimethylsily... CAS#:82053-13-2
Detail
|
| Literature: Higuchi, Katsumi; Onaka, Makoto; Izumi, Yusuke Bulletin of the Chemical Society of Japan, 1993 , vol. 66, # 7 p. 2016 - 2032 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-trimethylsilyloxycyclohex-2-enecarbonitrile |
| 2-Cyclohexene-1-carbonitrile,1-[(trimethylsilyl)oxy] |
| 1-trimethylsilyloxy-1-cyclohexenecarbonitrile |
| (1-cyanocyclohex-2-en-1-yloxy)trimethylsilane |
| 1-trimethylsilyloxy-2-cyclohexenecarbonitrile |
| 1-cyano-1-trimethylsilyloxy-2-cyclohexene |
| 1-(trimethylsiloxy)cyclohex-2-enecarbonitrile |
| 1-trimethylsiloxy-2-cyclohexene-1-carbonitrile |