Monoanilinogossypol structure
|
Common Name | Monoanilinogossypol | ||
|---|---|---|---|---|
| CAS Number | 82085-03-8 | Molecular Weight | 593.66600 | |
| Density | 1.403g/cm3 | Boiling Point | 795.7ºC at 760 mmHg | |
| Molecular Formula | C36H35NO7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 435ºC | |
| Name | 7-[8-(anilinomethylidene)-1,6-dihydroxy-3-methyl-7-oxo-5-propan-2-ylnaphthalen-2-yl]-2,3,8-trihydroxy-6-methyl-4-propan-2-ylnaphthalene-1-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.403g/cm3 |
|---|---|
| Boiling Point | 795.7ºC at 760 mmHg |
| Molecular Formula | C36H35NO7 |
| Molecular Weight | 593.66600 |
| Flash Point | 435ºC |
| Exact Mass | 593.24100 |
| PSA | 147.32000 |
| LogP | 7.91570 |
| Index of Refraction | 1.76 |
| InChIKey | LXESRBFDJFLHML-UHFFFAOYSA-N |
| SMILES | Cc1cc2c(C(C)C)c(O)c(O)c(C=O)c2c(O)c1-c1c(C)cc2c(C(C)C)c(O)c(O)c(C=Nc3ccccc3)c2c1O |
|
~63%
Monoanilinogossypol CAS#:82085-03-8 |
| Literature: Tilyabaev; Kamaev; Vypova; Yuldashev; Ibragimov; Talipov Russian Journal of Bioorganic Chemistry, 2010 , vol. 36, # 3 p. 390 - 395 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| (2,2'-Binaphthalene)-8-carboxaldehyde,1,1',6,6',7,7'-hexahydroxy-3,3'-dimethyl-5,5'-bis(1-methylethyl)-8'-((phenylimino)methyl) |
| Monoanilinogossypol |