tributyl-[3-ethenyl-2,4-bis(methoxymethyl)phenyl]stannane structure
|
Common Name | tributyl-[3-ethenyl-2,4-bis(methoxymethyl)phenyl]stannane | ||
|---|---|---|---|---|
| CAS Number | 820964-85-0 | Molecular Weight | 481.29000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H42O2Sn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tributyl-[3-ethenyl-2,4-bis(methoxymethyl)phenyl]stannane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C24H42O2Sn |
|---|---|
| Molecular Weight | 481.29000 |
| Exact Mass | 482.22100 |
| PSA | 18.46000 |
| LogP | 6.90360 |
| InChIKey | VWTXPWKWFMGRCR-UHFFFAOYSA-N |
| SMILES | C=Cc1c(COC)ccc([Sn](CCCC)(CCCC)CCCC)c1COC |
|
~64%
tributyl-[3-eth... CAS#:820964-85-0 |
| Literature: Nakao, Yoshiaki; Hirata, Yasuhiro; Ishihara, Shinjiro; Oda, Shinichi; Yukawa, Tomoya; Shirakawa, Eiji; Hiyama, Tamejiro Journal of the American Chemical Society, 2004 , vol. 126, # 48 p. 15650 - 15651 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Stannane,tributyl[3-ethenyl-2,4-bis(methoxymethyl)phenyl] |