4-[3-(3-cyanopropyl)-2-ethenyl-4-tributylstannylphenyl]butanenitrile structure
|
Common Name | 4-[3-(3-cyanopropyl)-2-ethenyl-4-tributylstannylphenyl]butanenitrile | ||
|---|---|---|---|---|
| CAS Number | 820964-86-1 | Molecular Weight | 527.36300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H44N2Sn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[3-(3-cyanopropyl)-2-ethenyl-4-tributylstannylphenyl]butanenitrile |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C28H44N2Sn |
|---|---|
| Molecular Weight | 527.36300 |
| Exact Mass | 528.25300 |
| PSA | 47.58000 |
| LogP | 8.30336 |
| InChIKey | WXBOVDBXQOKCGI-UHFFFAOYSA-N |
| SMILES | C=Cc1c(CCCC#N)ccc([Sn](CCCC)(CCCC)CCCC)c1CCCC#N |
|
~64%
4-[3-(3-cyanopr... CAS#:820964-86-1 |
| Literature: Nakao, Yoshiaki; Hirata, Yasuhiro; Ishihara, Shinjiro; Oda, Shinichi; Yukawa, Tomoya; Shirakawa, Eiji; Hiyama, Tamejiro Journal of the American Chemical Society, 2004 , vol. 126, # 48 p. 15650 - 15651 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,3-Benzenedibutanenitrile,2-ethenyl-4-(tributylstannyl) |