1-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-3,4,5-trimethyl-pyrazole structure
|
Common Name | 1-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-3,4,5-trimethyl-pyrazole | ||
|---|---|---|---|---|
| CAS Number | 82100-82-1 | Molecular Weight | 348.26100 | |
| Density | 1.49g/cm3 | Boiling Point | 514ºC at 760 mmHg | |
| Molecular Formula | C15H14BrN3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 264.6ºC | |
| Name | 4-(4-bromophenyl)-2-(3,4,5-trimethylpyrazol-1-yl)-1,3-thiazole |
|---|
| Density | 1.49g/cm3 |
|---|---|
| Boiling Point | 514ºC at 760 mmHg |
| Molecular Formula | C15H14BrN3S |
| Molecular Weight | 348.26100 |
| Flash Point | 264.6ºC |
| Exact Mass | 347.00900 |
| PSA | 58.95000 |
| LogP | 4.68350 |
| Index of Refraction | 1.687 |
| InChIKey | ISWBNTUCGOVSEO-UHFFFAOYSA-N |
| SMILES | Cc1nn(-c2nc(-c3ccc(Br)cc3)cs2)c(C)c1C |
|
~55%
1-[4-(4-bromoph... CAS#:82100-82-1 |
| Literature: Singh, S. P.; Kodali, Dharma R.; Dhindsa, G. S.; Sawhney, S. N. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1982 , vol. 21, # 1 p. 30 - 33 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |