(Z)-ethyl 2-(5-benzylidene-4-oxo-2-thioxothiazolidin-3-yl)acetate
Modify Date: 2026-05-06 17:23:56
(Z)-ethyl 2-(5-benzylidene-4-oxo-2-thioxothiazolidin-3-yl)acetate structure
|
Common Name | (Z)-ethyl 2-(5-benzylidene-4-oxo-2-thioxothiazolidin-3-yl)acetate | ||
|---|---|---|---|---|
| CAS Number | 82159-07-7 | Molecular Weight | 307.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H13NO3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (Z)-ethyl 2-(5-benzylidene-4-oxo-2-thioxothiazolidin-3-yl)acetate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H13NO3S2 |
|---|---|
| Molecular Weight | 307.4 |
| InChIKey | RWWQKWATJKMLLI-FLIBITNWSA-N |
| SMILES | CCOC(=O)CN1C(=O)/C(=C/C2=CC=CC=C2)/SC1=S |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Discovery of Small Molecules to Inhibit Human Cytomegalovirus Nuclear Egress
Source: ICCB-Longwood/NSRB Screening Facility, Harvard Medical School
Target: HCMV UL50
External Id: HMS1262
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of (Z)-ethyl 2-(5-benzylidene-4-oxo-2-thioxothiazolidin-3-yl)acetate? |
| A: CAS number of (Z)-ethyl 2-(5-benzylidene-4-oxo-2-thioxothiazolidin-3-yl)acetate is 82159-07-7. |
| Q: What is the Chinese name of 82159-07-7? |
| A: Chinese name of 82159-07-7 is 82159-07-7. |
| Q: What is the SMILES notation of (Z)-ethyl 2-(5-benzylidene-4-oxo-2-thioxothiazolidin-3-yl)acetate? |
| A: SMILES notation of (Z)-ethyl 2-(5-benzylidene-4-oxo-2-thioxothiazolidin-3-yl)acetate is CCOC(=O)CN1C(=O)/C(=C/C2=CC=CC=C2)/SC1=S. |
| Q: What is the English name of (Z)-ethyl 2-(5-benzylidene-4-oxo-2-thioxothiazolidin-3-yl)acetate? |
| A: The English name of (Z)-ethyl 2-(5-benzylidene-4-oxo-2-thioxothiazolidin-3-yl)acetate is (Z)-ethyl 2-(5-benzylidene-4-oxo-2-thioxothiazolidin-3-yl)acetate. |
| Q: What is the InChIKey of (Z)-ethyl 2-(5-benzylidene-4-oxo-2-thioxothiazolidin-3-yl)acetate? |
| A: InChIKey of (Z)-ethyl 2-(5-benzylidene-4-oxo-2-thioxothiazolidin-3-yl)acetate is RWWQKWATJKMLLI-FLIBITNWSA-N. |
| Q: What is the molecular formula of (Z)-ethyl 2-(5-benzylidene-4-oxo-2-thioxothiazolidin-3-yl)acetate? |
| A: Molecular formula of (Z)-ethyl 2-(5-benzylidene-4-oxo-2-thioxothiazolidin-3-yl)acetate is C14H13NO3S2. |
| Q: What is the molecular weight of (Z)-ethyl 2-(5-benzylidene-4-oxo-2-thioxothiazolidin-3-yl)acetate? |
| A: Molecular weight of (Z)-ethyl 2-(5-benzylidene-4-oxo-2-thioxothiazolidin-3-yl)acetate is 307.4. |