[1-(4-methylphenyl)sulfonylaziridin-2-yl]-phenylmethanone structure
|
Common Name | [1-(4-methylphenyl)sulfonylaziridin-2-yl]-phenylmethanone | ||
|---|---|---|---|---|
| CAS Number | 821796-68-3 | Molecular Weight | 301.36000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H15NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [1-(4-methylphenyl)sulfonylaziridin-2-yl]-phenylmethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H15NO3S |
|---|---|
| Molecular Weight | 301.36000 |
| Exact Mass | 301.07700 |
| PSA | 62.60000 |
| LogP | 3.26950 |
| InChIKey | KEDBVWKGBMUMAY-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)N2CC2C(=O)c2ccccc2)cc1 |
|
~%
[1-(4-methylphe... CAS#:821796-68-3 |
| Literature: Ogawa, Yasuyuki; Kuroda, Kiichi; Mukaiyama, Teruaki Bulletin of the Chemical Society of Japan, 2005 , vol. 78, # 7 p. 1309 - 1333 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-benzoyl-1-tosyl-aziridine |
| Aziridine,2-benzoyl-1-[(4-methylphenyl)sulfonyl] |