sodium,6,7-dimethylnaphthalene-1-sulfonate,formaldehyde structure
|
Common Name | sodium,6,7-dimethylnaphthalene-1-sulfonate,formaldehyde | ||
|---|---|---|---|---|
| CAS Number | 82199-01-7 | Molecular Weight | 288.29500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H13NaO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | sodium,6,7-dimethylnaphthalene-1-sulfonate,formaldehyde |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H13NaO4S |
|---|---|
| Molecular Weight | 288.29500 |
| Exact Mass | 288.04300 |
| PSA | 82.65000 |
| LogP | 3.89250 |
| InChIKey | NZJZESFWUYOSTM-UHFFFAOYSA-M |
| SMILES | C=O.Cc1cc2cccc(S(=O)(=O)[O-])c2cc1C.[Na+] |
| Naphthalenesulfonic acid,1,6-dimethyl-,sodium salt,polymer with formaldehyde |
| Naphthalenesulfonic acid,1,6-dimethyl-,sodium salt (1:1),polymer with formaldehyde |