4,5-diphenyl-5-prop-2-enyl-1,3-oxazol-2-one structure
|
Common Name | 4,5-diphenyl-5-prop-2-enyl-1,3-oxazol-2-one | ||
|---|---|---|---|---|
| CAS Number | 82238-48-0 | Molecular Weight | 277.31700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4,5-diphenyl-5-prop-2-enyl-1,3-oxazol-2-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H15NO2 |
|---|---|
| Molecular Weight | 277.31700 |
| Exact Mass | 277.11000 |
| PSA | 38.66000 |
| LogP | 3.53310 |
| InChIKey | VFEAVNMZKQOLJD-UHFFFAOYSA-N |
| SMILES | C=CCC1(c2ccccc2)OC(=O)N=C1c1ccccc1 |
|
~%
4,5-diphenyl-5-... CAS#:82238-48-0 |
| Literature: Padwa, Albert; Cohen, Leslie A. Journal of Organic Chemistry, 1984 , vol. 49, # 3 p. 399 - 406 |
|
~75%
4,5-diphenyl-5-... CAS#:82238-48-0 |
| Literature: Padwa, Albert; Cohen, Leslie A. Journal of Organic Chemistry, 1984 , vol. 49, # 3 p. 399 - 406 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2(5H)-Oxazolone,4,5-diphenyl-5-(2-propenyl) |
| 5-allyl-4,5-diphenyl-3-oxazolin-2-one |
| 5-allyl-4,5-diphenyl-1,3-oxazol-2(5H)-one |
| 5-allyl-4,5-diphenyl-oxazol-2-one |