H-DL-Ala-DL-Leu-Gly-OH structure
|
Common Name | H-DL-Ala-DL-Leu-Gly-OH | ||
|---|---|---|---|---|
| CAS Number | 82267-71-8 | Molecular Weight | 259.30200 | |
| Density | 1.171g/cm3 | Boiling Point | 566.1ºC at 760mmHg | |
| Molecular Formula | C11H21N3O4 | Melting Point | 197-199ºC | |
| MSDS | Chinese USA | Flash Point | 296.1ºC | |
| Name | 2-[[2-(2-aminopropanoylamino)-4-methylpentanoyl]amino]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.171g/cm3 |
|---|---|
| Boiling Point | 566.1ºC at 760mmHg |
| Melting Point | 197-199ºC |
| Molecular Formula | C11H21N3O4 |
| Molecular Weight | 259.30200 |
| Flash Point | 296.1ºC |
| Exact Mass | 259.15300 |
| PSA | 121.52000 |
| LogP | 0.54740 |
| Index of Refraction | 1.501 |
| InChIKey | MNZHHDPWDWQJCQ-UHFFFAOYSA-N |
| SMILES | CC(C)CC(NC(=O)C(C)N)C(=O)NCC(=O)O |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| HS Code | 2924199090 |
|
~%
H-DL-Ala-DL-Leu... CAS#:82267-71-8 |
| Literature: Justus Liebigs Annalen der Chemie, , vol. 340, p. 149 |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| H-DL-Ala-DL-Leu-Gly-OH |
| DL-Ala-DL-Leu-Gly |
| 2-[2-(2-aminopropanoylamino)-4-methylpentanoylamino]acetic acid |
| alanyl=>leucyl=>-glycine |