ethyl 5-[(2-chlorophenyl)sulfanylmethyl]-1,2-oxazole-3-carboxylate structure
|
Common Name | ethyl 5-[(2-chlorophenyl)sulfanylmethyl]-1,2-oxazole-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 823219-92-7 | Molecular Weight | 297.75700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H12ClNO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 5-[(2-chlorophenyl)sulfanylmethyl]-1,2-oxazole-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H12ClNO3S |
|---|---|
| Molecular Weight | 297.75700 |
| Exact Mass | 297.02300 |
| PSA | 77.63000 |
| LogP | 3.79700 |
| InChIKey | NMBNCGUTFSXPQW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc(CSc2ccccc2Cl)on1 |
|
~%
ethyl 5-[(2-chl... CAS#:823219-92-7 |
| Literature: Cali, Patrizia; Naerum, Lars; Mukhija, Seema; Hjelmencrantz, Anders Bioorganic and Medicinal Chemistry Letters, 2004 , vol. 14, # 24 p. 5997 - 6000 |
|
~%
ethyl 5-[(2-chl... CAS#:823219-92-7 |
| Literature: Cali, Patrizia; Naerum, Lars; Mukhija, Seema; Hjelmencrantz, Anders Bioorganic and Medicinal Chemistry Letters, 2004 , vol. 14, # 24 p. 5997 - 6000 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3-Isoxazolecarboxylic acid,5-[[(2-chlorophenyl)thio]methyl]-,ethyl ester |