2,8-dinitro-10H-phenothiazine structure
|
Common Name | 2,8-dinitro-10H-phenothiazine | ||
|---|---|---|---|---|
| CAS Number | 823802-43-3 | Molecular Weight | 289.26700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H7N3O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,8-dinitro-10H-phenothiazine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H7N3O4S |
|---|---|
| Molecular Weight | 289.26700 |
| Exact Mass | 289.01600 |
| PSA | 128.97000 |
| LogP | 4.89560 |
| InChIKey | MRFMKCMMSFCWHW-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc2c(c1)Nc1cc([N+](=O)[O-])ccc1S2 |
|
~%
2,8-dinitro-10H... CAS#:823802-43-3 |
| Literature: Michels; Amstutz Journal of the American Chemical Society, 1950 , vol. 72, p. 888,891 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2,8-dinitro-phenothiazine |
| 10H-Phenothiazine,2,8-dinitro |