2,2,4,5,6,7-Hexachloro-1H-indene-1,3(2H)-dione structure
|
Common Name | 2,2,4,5,6,7-Hexachloro-1H-indene-1,3(2H)-dione | ||
|---|---|---|---|---|
| CAS Number | 82381-17-7 | Molecular Weight | 352.81300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9Cl6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | hexachloroindanedione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9Cl6O2 |
|---|---|
| Molecular Weight | 352.81300 |
| Exact Mass | 349.80300 |
| PSA | 34.14000 |
| LogP | 4.85310 |
| InChIKey | WJHXJYUKJVLCRB-UHFFFAOYSA-N |
| SMILES | O=C1c2c(Cl)c(Cl)c(Cl)c(Cl)c2C(=O)C1(Cl)Cl |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2,2,4,5,6,7-Hexachloro-1H-indene-1,3(2H)-dione |
| Hexachlor-1.3-dioxo-hydrinden |
| Perchlor-α.γ-diketo-hydrinden |
| Hexachlorindandion-(1.3) |
| Hexachlor-indan-1,3-dion |
| hexachloro-indan-1,3-dione |
| 2,2,4,5,6,7-Hexachlor indandion-(1,3)-[14C] |