N-[4-(2,4-dimethoxyphenyl)-4-oxobutyl]acetamide
![N-[4-(2,4-dimethoxyphenyl)-4-oxobutyl]acetamide Structure](https://image.chemsrc.com/caspic/256/823821-74-5.png)
N-[4-(2,4-dimethoxyphenyl)-4-oxobutyl]acetamide structure
|
Common Name | N-[4-(2,4-dimethoxyphenyl)-4-oxobutyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 823821-74-5 | Molecular Weight | 265.30500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-[4-(2,4-dimethoxyphenyl)-4-oxobutyl]acetamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H19NO4 |
|---|---|
| Molecular Weight | 265.30500 |
| Exact Mass | 265.13100 |
| PSA | 68.12000 |
| LogP | 2.64310 |
| InChIKey | KYZPQJNEEGKKNH-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)CCCNC(C)=O)c(OC)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~68%
N-[4-(2,4-dimet... CAS#:823821-74-5 |
| Literature: Nenajdenko, Valentine G.; Zakurdaev, Eugene P.; Prusov, Eugene V.; Balenkova, Elizabeth S. Tetrahedron, 2004 , vol. 60, # 51 p. 11719 - 11724 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-(4-oxo-4-(2,4-dimethoxyphenyl)butyl)acetamide |
| Acetamide,N-[4-(2,4-dimethoxyphenyl)-4-oxobutyl] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of N-[4-(2,4-dimethoxyphenyl)-4-oxobutyl]acetamide? |
| A: InChIKey of N-[4-(2,4-dimethoxyphenyl)-4-oxobutyl]acetamide is KYZPQJNEEGKKNH-UHFFFAOYSA-N. |
| Q: What is the CAS number of N-[4-(2,4-dimethoxyphenyl)-4-oxobutyl]acetamide? |
| A: CAS number of N-[4-(2,4-dimethoxyphenyl)-4-oxobutyl]acetamide is 823821-74-5. |
| Q: What English synonyms does N-[4-(2,4-dimethoxyphenyl)-4-oxobutyl]acetamide have? |
| A: English synonyms of N-[4-(2,4-dimethoxyphenyl)-4-oxobutyl]acetamide: N-(4-oxo-4-(2,4-dimethoxyphenyl)butyl)acetamide, Acetamide,N-[4-(2,4-dimethoxyphenyl)-4-oxobutyl]. |
| Q: What is the Chinese name of 823821-74-5? |
| A: Chinese name of 823821-74-5 is 823821-74-5. |
| Q: What is the English name of N-[4-(2,4-dimethoxyphenyl)-4-oxobutyl]acetamide? |
| A: The English name of N-[4-(2,4-dimethoxyphenyl)-4-oxobutyl]acetamide is N-[4-(2,4-dimethoxyphenyl)-4-oxobutyl]acetamide. |
| Q: What is the molecular weight of N-[4-(2,4-dimethoxyphenyl)-4-oxobutyl]acetamide? |
| A: Molecular weight of N-[4-(2,4-dimethoxyphenyl)-4-oxobutyl]acetamide is 265.30500. |
| Q: What is the polar surface area (PSA) of N-[4-(2,4-dimethoxyphenyl)-4-oxobutyl]acetamide? |
| A: Polar surface area (PSA) of N-[4-(2,4-dimethoxyphenyl)-4-oxobutyl]acetamide is 68.12000. |
| Q: What are the upstream materials of N-[4-(2,4-dimethoxyphenyl)-4-oxobutyl]acetamide? |
| A: Related upstream materials(CAS) of N-[4-(2,4-dimethoxyphenyl)-4-oxobutyl]acetamide: 91640-95-8. |
| Q: What is the LogP of N-[4-(2,4-dimethoxyphenyl)-4-oxobutyl]acetamide? |
| A: LogP of N-[4-(2,4-dimethoxyphenyl)-4-oxobutyl]acetamide is 2.64310. |
| Q: What is the SMILES notation of N-[4-(2,4-dimethoxyphenyl)-4-oxobutyl]acetamide? |
| A: SMILES notation of N-[4-(2,4-dimethoxyphenyl)-4-oxobutyl]acetamide is COc1ccc(C(=O)CCCNC(C)=O)c(OC)c1. |