1-(2,4-dimethoxyphenyl)-2-[(4-methoxyphenyl)methylsulfanyl]ethanone
![1-(2,4-dimethoxyphenyl)-2-[(4-methoxyphenyl)methylsulfanyl]ethanone Structure](https://image.chemsrc.com/caspic/465/823829-25-0.png)
1-(2,4-dimethoxyphenyl)-2-[(4-methoxyphenyl)methylsulfanyl]ethanone structure
|
Common Name | 1-(2,4-dimethoxyphenyl)-2-[(4-methoxyphenyl)methylsulfanyl]ethanone | ||
|---|---|---|---|---|
| CAS Number | 823829-25-0 | Molecular Weight | 332.41400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H20O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(2,4-dimethoxyphenyl)-2-[(4-methoxyphenyl)methylsulfanyl]ethanone |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H20O4S |
|---|---|
| Molecular Weight | 332.41400 |
| Exact Mass | 332.10800 |
| PSA | 70.06000 |
| LogP | 3.82850 |
| InChIKey | KQBROFMXMFDEKB-UHFFFAOYSA-N |
| SMILES | COc1ccc(CSCC(=O)c2ccc(OC)cc2OC)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~96%
1-(2,4-dimethox... CAS#:823829-25-0 |
| Literature: Macmillan, Derek; Anderson, David W. Organic Letters, 2004 , vol. 6, # 25 p. 4659 - 4662 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Ethanone,1-(2,4-dimethoxyphenyl)-2-[[(4-methoxyphenyl)methyl]thio] |
| 2-keto-2-(2,4-dimethoxyphenyl)(S-p-methoxybenzyl)ethanethiol |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 1-(2,4-dimethoxyphenyl)-2-[(4-methoxyphenyl)methylsulfanyl]ethanone have? |
| A: English synonyms of 1-(2,4-dimethoxyphenyl)-2-[(4-methoxyphenyl)methylsulfanyl]ethanone: Ethanone,1-(2,4-dimethoxyphenyl)-2-[[(4-methoxyphenyl)methyl]thio], 2-keto-2-(2,4-dimethoxyphenyl)(S-p-methoxybenzyl)ethanethiol. |
| Q: What are the upstream materials of 1-(2,4-dimethoxyphenyl)-2-[(4-methoxyphenyl)methylsulfanyl]ethanone? |
| A: Related upstream materials(CAS) of 1-(2,4-dimethoxyphenyl)-2-[(4-methoxyphenyl)methylsulfanyl]ethanone: 60965-26-6;6258-60-2. |
| Q: What is the English name of 1-(2,4-dimethoxyphenyl)-2-[(4-methoxyphenyl)methylsulfanyl]ethanone? |
| A: The English name of 1-(2,4-dimethoxyphenyl)-2-[(4-methoxyphenyl)methylsulfanyl]ethanone is 1-(2,4-dimethoxyphenyl)-2-[(4-methoxyphenyl)methylsulfanyl]ethanone. |
| Q: What is the molecular formula of 1-(2,4-dimethoxyphenyl)-2-[(4-methoxyphenyl)methylsulfanyl]ethanone? |
| A: Molecular formula of 1-(2,4-dimethoxyphenyl)-2-[(4-methoxyphenyl)methylsulfanyl]ethanone is C18H20O4S. |
| Q: What is the CAS number of 1-(2,4-dimethoxyphenyl)-2-[(4-methoxyphenyl)methylsulfanyl]ethanone? |
| A: CAS number of 1-(2,4-dimethoxyphenyl)-2-[(4-methoxyphenyl)methylsulfanyl]ethanone is 823829-25-0. |
| Q: What is the molecular weight of 1-(2,4-dimethoxyphenyl)-2-[(4-methoxyphenyl)methylsulfanyl]ethanone? |
| A: Molecular weight of 1-(2,4-dimethoxyphenyl)-2-[(4-methoxyphenyl)methylsulfanyl]ethanone is 332.41400. |
| Q: What is the SMILES notation of 1-(2,4-dimethoxyphenyl)-2-[(4-methoxyphenyl)methylsulfanyl]ethanone? |
| A: SMILES notation of 1-(2,4-dimethoxyphenyl)-2-[(4-methoxyphenyl)methylsulfanyl]ethanone is COc1ccc(CSCC(=O)c2ccc(OC)cc2OC)cc1. |
| Q: What is the InChIKey of 1-(2,4-dimethoxyphenyl)-2-[(4-methoxyphenyl)methylsulfanyl]ethanone? |
| A: InChIKey of 1-(2,4-dimethoxyphenyl)-2-[(4-methoxyphenyl)methylsulfanyl]ethanone is KQBROFMXMFDEKB-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 1-(2,4-dimethoxyphenyl)-2-[(4-methoxyphenyl)methylsulfanyl]ethanone? |
| A: Polar surface area (PSA) of 1-(2,4-dimethoxyphenyl)-2-[(4-methoxyphenyl)methylsulfanyl]ethanone is 70.06000. |
| Q: What is the Chinese name of 823829-25-0? |
| A: Chinese name of 823829-25-0 is 823829-25-0. |