2-(4-prop-2-enoylphenoxy)ethyl acetate
2-(4-prop-2-enoylphenoxy)ethyl acetate structure
|
Common Name | 2-(4-prop-2-enoylphenoxy)ethyl acetate | ||
|---|---|---|---|---|
| CAS Number | 82397-89-5 | Molecular Weight | 234.24800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(4-prop-2-enoylphenoxy)ethyl acetate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H14O4 |
|---|---|
| Molecular Weight | 234.24800 |
| Exact Mass | 234.08900 |
| PSA | 52.60000 |
| LogP | 1.99720 |
| InChIKey | DUNYJXAASMQKPQ-UHFFFAOYSA-N |
| SMILES | C=CC(=O)c1ccc(OCCOC(C)=O)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~57%
2-(4-prop-2-eno... CAS#:82397-89-5 |
| Literature: Zvara, Ivan; Lukac, Ivan; Hrdlovic, Pavol; Chmela, Stefan Collection of Czechoslovak Chemical Communications, 1982 , vol. 47, # 3 p. 908 - 911 |
|
~%
2-(4-prop-2-eno... CAS#:82397-89-5 |
| Literature: Zvara, Ivan; Lukac, Ivan; Hrdlovic, Pavol; Chmela, Stefan Collection of Czechoslovak Chemical Communications, 1982 , vol. 47, # 3 p. 908 - 911 |
![2-[4-(3-chloropropanoyl)phenoxy]ethyl acetate structure](https://image.chemsrc.com/caspic/065/82408-98-8.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Propen-1-one,1-[4-[2-(acetyloxy)ethoxy]phenyl] |
| 1-[4-(2-Acetoxyethoxy)phenyl]-2-propen-1-one |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 2-(4-prop-2-enoylphenoxy)ethyl acetate have? |
| A: English synonyms of 2-(4-prop-2-enoylphenoxy)ethyl acetate: 2-Propen-1-one,1-[4-[2-(acetyloxy)ethoxy]phenyl], 1-[4-(2-Acetoxyethoxy)phenyl]-2-propen-1-one. |
| Q: What is the Chinese name of 82397-89-5? |
| A: Chinese name of 82397-89-5 is 82397-89-5. |
| Q: What is the polar surface area (PSA) of 2-(4-prop-2-enoylphenoxy)ethyl acetate? |
| A: Polar surface area (PSA) of 2-(4-prop-2-enoylphenoxy)ethyl acetate is 52.60000. |
| Q: What is the LogP of 2-(4-prop-2-enoylphenoxy)ethyl acetate? |
| A: LogP of 2-(4-prop-2-enoylphenoxy)ethyl acetate is 1.99720. |
| Q: What is the SMILES notation of 2-(4-prop-2-enoylphenoxy)ethyl acetate? |
| A: SMILES notation of 2-(4-prop-2-enoylphenoxy)ethyl acetate is C=CC(=O)c1ccc(OCCOC(C)=O)cc1. |
| Q: What is the molecular formula of 2-(4-prop-2-enoylphenoxy)ethyl acetate? |
| A: Molecular formula of 2-(4-prop-2-enoylphenoxy)ethyl acetate is C13H14O4. |
| Q: What is the molecular weight of 2-(4-prop-2-enoylphenoxy)ethyl acetate? |
| A: Molecular weight of 2-(4-prop-2-enoylphenoxy)ethyl acetate is 234.24800. |
| Q: What is the CAS number of 2-(4-prop-2-enoylphenoxy)ethyl acetate? |
| A: CAS number of 2-(4-prop-2-enoylphenoxy)ethyl acetate is 82397-89-5. |
| Q: What are the upstream materials of 2-(4-prop-2-enoylphenoxy)ethyl acetate? |
| A: Related upstream materials(CAS) of 2-(4-prop-2-enoylphenoxy)ethyl acetate: 82408-98-8;6192-44-5. |
| Q: What is the InChIKey of 2-(4-prop-2-enoylphenoxy)ethyl acetate? |
| A: InChIKey of 2-(4-prop-2-enoylphenoxy)ethyl acetate is DUNYJXAASMQKPQ-UHFFFAOYSA-N. |