N-(2-bromoethyl)naphthalene-2-carboxamide
N-(2-bromoethyl)naphthalene-2-carboxamide structure
|
Common Name | N-(2-bromoethyl)naphthalene-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 82408-26-2 | Molecular Weight | 278.14400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H12BrNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(2-bromoethyl)naphthalene-2-carboxamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H12BrNO |
|---|---|
| Molecular Weight | 278.14400 |
| Exact Mass | 277.01000 |
| PSA | 32.59000 |
| LogP | 3.53930 |
| InChIKey | VCYHLRALQHNLMN-UHFFFAOYSA-N |
| SMILES | O=C(NCCBr)c1ccc2ccccc2c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~32%
N-(2-bromoethyl... CAS#:82408-26-2 |
| Literature: Nishimoto, Sei-ichi; Izukawa, Tsukuru; Kagiya, Tsutomu Bulletin of the Chemical Society of Japan, 1982 , vol. 55, # 9 p. 2937 - 2941 |
|
~%
N-(2-bromoethyl... CAS#:82408-26-2 |
| Literature: Nishimoto, Sei-ichi; Izukawa, Tsukuru; Kagiya, Tsutomu Bulletin of the Chemical Society of Japan, 1982 , vol. 55, # 5 p. 1484 - 1488 |
|
~%
N-(2-bromoethyl... CAS#:82408-26-2 |
| Literature: Nishimoto, Sei-ichi; Izukawa, Tsukuru; Kagiya, Tsutomu Bulletin of the Chemical Society of Japan, 1982 , vol. 55, # 5 p. 1484 - 1488 |
|
~%
N-(2-bromoethyl... CAS#:82408-26-2 |
| Literature: Saulmann Chemische Berichte, 1900 , vol. 33, p. 2637 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Naphthalenecarboxamide,N-(2-bromoethyl) |
| N-(2-bromo-ethyl)-[2]naphthamide |
| N-(2-Brom-aethyl)-[2]naphthamid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of N-(2-bromoethyl)naphthalene-2-carboxamide? |
| A: LogP of N-(2-bromoethyl)naphthalene-2-carboxamide is 3.53930. |
| Q: What are the upstream materials of N-(2-bromoethyl)naphthalene-2-carboxamide? |
| A: Related upstream materials(CAS) of N-(2-bromoethyl)naphthalene-2-carboxamide: 63021-45-4;2243-83-6;2576-47-8. |
| Q: What is the InChIKey of N-(2-bromoethyl)naphthalene-2-carboxamide? |
| A: InChIKey of N-(2-bromoethyl)naphthalene-2-carboxamide is VCYHLRALQHNLMN-UHFFFAOYSA-N. |
| Q: What is the English name of N-(2-bromoethyl)naphthalene-2-carboxamide? |
| A: The English name of N-(2-bromoethyl)naphthalene-2-carboxamide is N-(2-bromoethyl)naphthalene-2-carboxamide. |
| Q: What is the polar surface area (PSA) of N-(2-bromoethyl)naphthalene-2-carboxamide? |
| A: Polar surface area (PSA) of N-(2-bromoethyl)naphthalene-2-carboxamide is 32.59000. |
| Q: What is the molecular weight of N-(2-bromoethyl)naphthalene-2-carboxamide? |
| A: Molecular weight of N-(2-bromoethyl)naphthalene-2-carboxamide is 278.14400. |
| Q: What English synonyms does N-(2-bromoethyl)naphthalene-2-carboxamide have? |
| A: English synonyms of N-(2-bromoethyl)naphthalene-2-carboxamide: 2-Naphthalenecarboxamide,N-(2-bromoethyl), N-(2-bromo-ethyl)-[2]naphthamide, N-(2-Brom-aethyl)-[2]naphthamid. |
| Q: What is the molecular formula of N-(2-bromoethyl)naphthalene-2-carboxamide? |
| A: Molecular formula of N-(2-bromoethyl)naphthalene-2-carboxamide is C13H12BrNO. |
| Q: What is the SMILES notation of N-(2-bromoethyl)naphthalene-2-carboxamide? |
| A: SMILES notation of N-(2-bromoethyl)naphthalene-2-carboxamide is O=C(NCCBr)c1ccc2ccccc2c1. |
| Q: What is the CAS number of N-(2-bromoethyl)naphthalene-2-carboxamide? |
| A: CAS number of N-(2-bromoethyl)naphthalene-2-carboxamide is 82408-26-2. |