7-anilino-4-methylcoumarin-3-acetic acid
7-anilino-4-methylcoumarin-3-acetic acid structure
|
Common Name | 7-anilino-4-methylcoumarin-3-acetic acid | ||
|---|---|---|---|---|
| CAS Number | 82412-16-6 | Molecular Weight | 309.31600 | |
| Density | 1.337g/cm3 | Boiling Point | 545.8ºC at 760 mmHg | |
| Molecular Formula | C18H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 283.9ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(7-anilino-4-methyl-2-oxochromen-3-yl)acetic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.337g/cm3 |
|---|---|
| Boiling Point | 545.8ºC at 760 mmHg |
| Molecular Formula | C18H15NO4 |
| Molecular Weight | 309.31600 |
| Flash Point | 283.9ºC |
| Exact Mass | 309.10000 |
| PSA | 79.54000 |
| LogP | 3.54510 |
| Index of Refraction | 1.653 |
| InChIKey | CQPFKBKIRKTCME-UHFFFAOYSA-N |
| SMILES | Cc1c(CC(=O)O)c(=O)oc2cc(Nc3ccccc3)ccc12 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
7-anilino-4-met... CAS#:82412-16-6 |
| Literature: Goya; Takadate; Fujino; Otagiri; Uekama Chemical and Pharmaceutical Bulletin, 1982 , vol. 30, # 4 p. 1363 - 1369 |
|
~%
7-anilino-4-met... CAS#:82412-16-6 |
| Literature: Goya; Takadate; Fujino; Otagiri; Uekama Chemical and Pharmaceutical Bulletin, 1982 , vol. 30, # 4 p. 1363 - 1369 |
|
~%
7-anilino-4-met... CAS#:82412-16-6 |
| Literature: Goya; Takadate; Fujino; Otagiri; Uekama Chemical and Pharmaceutical Bulletin, 1982 , vol. 30, # 4 p. 1363 - 1369 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 7-Anilino-4-methylcoumarin-3-acetic acid |
| 2H-1-Benzopyran-3-acetic acid,4-methyl-2-oxo-7-(phenylamino) |
| 7-Anmca |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 2-(7-anilino-4-methyl-2-oxochromen-3-yl)acetic acid? |
| A: Polar surface area (PSA) of 2-(7-anilino-4-methyl-2-oxochromen-3-yl)acetic acid is 79.54000. |
| Q: What is the InChIKey of 2-(7-anilino-4-methyl-2-oxochromen-3-yl)acetic acid? |
| A: InChIKey of 2-(7-anilino-4-methyl-2-oxochromen-3-yl)acetic acid is CQPFKBKIRKTCME-UHFFFAOYSA-N. |
| Q: What is the LogP of 2-(7-anilino-4-methyl-2-oxochromen-3-yl)acetic acid? |
| A: LogP of 2-(7-anilino-4-methyl-2-oxochromen-3-yl)acetic acid is 3.54510. |
| Q: What is the molecular weight of 2-(7-anilino-4-methyl-2-oxochromen-3-yl)acetic acid? |
| A: Molecular weight of 2-(7-anilino-4-methyl-2-oxochromen-3-yl)acetic acid is 309.31600. |
| Q: What is the SMILES notation of 2-(7-anilino-4-methyl-2-oxochromen-3-yl)acetic acid? |
| A: SMILES notation of 2-(7-anilino-4-methyl-2-oxochromen-3-yl)acetic acid is Cc1c(CC(=O)O)c(=O)oc2cc(Nc3ccccc3)ccc12. |
| Q: What English synonyms does 2-(7-anilino-4-methyl-2-oxochromen-3-yl)acetic acid have? |
| A: English synonyms of 2-(7-anilino-4-methyl-2-oxochromen-3-yl)acetic acid: 7-Anilino-4-methylcoumarin-3-acetic acid, 2H-1-Benzopyran-3-acetic acid,4-methyl-2-oxo-7-(phenylamino), 7-Anmca. |
| Q: What is the Chinese name of 82412-16-6? |
| A: Chinese name of 82412-16-6 is 82412-16-6. |
| Q: What is the CAS number of 2-(7-anilino-4-methyl-2-oxochromen-3-yl)acetic acid? |
| A: CAS number of 2-(7-anilino-4-methyl-2-oxochromen-3-yl)acetic acid is 82412-16-6. |
| Q: What is the English name of 2-(7-anilino-4-methyl-2-oxochromen-3-yl)acetic acid? |
| A: The English name of 2-(7-anilino-4-methyl-2-oxochromen-3-yl)acetic acid is 2-(7-anilino-4-methyl-2-oxochromen-3-yl)acetic acid. |
| Q: What are the upstream materials of 2-(7-anilino-4-methyl-2-oxochromen-3-yl)acetic acid? |
| A: Related upstream materials(CAS) of 2-(7-anilino-4-methyl-2-oxochromen-3-yl)acetic acid: 1115-30-6;101-18-8;82412-19-9. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |