7-anilino-4-methylcoumarin-3-acetic acid
Modify Date: 2025-08-27 17:44:40
7-anilino-4-methylcoumarin-3-acetic acid structure
|
Common Name | 7-anilino-4-methylcoumarin-3-acetic acid | ||
|---|---|---|---|---|
| CAS Number | 82412-16-6 | Molecular Weight | 309.31600 | |
| Density | 1.337g/cm3 | Boiling Point | 545.8ºC at 760 mmHg | |
| Molecular Formula | C18H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 283.9ºC | |
| Name | 2-(7-anilino-4-methyl-2-oxochromen-3-yl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.337g/cm3 |
|---|---|
| Boiling Point | 545.8ºC at 760 mmHg |
| Molecular Formula | C18H15NO4 |
| Molecular Weight | 309.31600 |
| Flash Point | 283.9ºC |
| Exact Mass | 309.10000 |
| PSA | 79.54000 |
| LogP | 3.54510 |
| Index of Refraction | 1.653 |
| InChIKey | CQPFKBKIRKTCME-UHFFFAOYSA-N |
| SMILES | Cc1c(CC(=O)O)c(=O)oc2cc(Nc3ccccc3)ccc12 |
|
~%
7-anilino-4-met... CAS#:82412-16-6 |
| Literature: Goya; Takadate; Fujino; Otagiri; Uekama Chemical and Pharmaceutical Bulletin, 1982 , vol. 30, # 4 p. 1363 - 1369 |
|
~%
7-anilino-4-met... CAS#:82412-16-6 |
| Literature: Goya; Takadate; Fujino; Otagiri; Uekama Chemical and Pharmaceutical Bulletin, 1982 , vol. 30, # 4 p. 1363 - 1369 |
|
~%
7-anilino-4-met... CAS#:82412-16-6 |
| Literature: Goya; Takadate; Fujino; Otagiri; Uekama Chemical and Pharmaceutical Bulletin, 1982 , vol. 30, # 4 p. 1363 - 1369 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 7-Anilino-4-methylcoumarin-3-acetic acid |
| 2H-1-Benzopyran-3-acetic acid,4-methyl-2-oxo-7-(phenylamino) |
| 7-Anmca |