Phenol, 3-chloro-2-fluoro-6-nitro
Phenol, 3-chloro-2-fluoro-6-nitro structure
|
Common Name | Phenol, 3-chloro-2-fluoro-6-nitro | ||
|---|---|---|---|---|
| CAS Number | 82419-40-7 | Molecular Weight | 191.54400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H3ClFNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-chloro-2-fluoro-6-nitrophenol |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H3ClFNO3 |
|---|---|
| Molecular Weight | 191.54400 |
| Exact Mass | 190.97900 |
| PSA | 66.05000 |
| LogP | 2.61610 |
| InChIKey | QHXNXZWZWUJJEE-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(Cl)c(F)c1O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~36%
Phenol, 3-chlor... CAS#:82419-40-7 |
| Literature: Daiichi Seiyaku Co., Ltd. Patent: US4382892 A1, 1983 ; |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-fluoro-3-chloro-6-nitrophenol |
| Phenol,3-chloro-2-fluoro-6-nitro |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 3-chloro-2-fluoro-6-nitrophenol? |
| A: Polar surface area (PSA) of 3-chloro-2-fluoro-6-nitrophenol is 66.05000. |
| Q: What is the molecular formula of 3-chloro-2-fluoro-6-nitrophenol? |
| A: Molecular formula of 3-chloro-2-fluoro-6-nitrophenol is C6H3ClFNO3. |
| Q: What are the upstream materials of 3-chloro-2-fluoro-6-nitrophenol? |
| A: Related upstream materials(CAS) of 3-chloro-2-fluoro-6-nitrophenol: 393-79-3. |
| Q: What is the molecular weight of 3-chloro-2-fluoro-6-nitrophenol? |
| A: Molecular weight of 3-chloro-2-fluoro-6-nitrophenol is 191.54400. |
| Q: What is the InChIKey of 3-chloro-2-fluoro-6-nitrophenol? |
| A: InChIKey of 3-chloro-2-fluoro-6-nitrophenol is QHXNXZWZWUJJEE-UHFFFAOYSA-N. |
| Q: What English synonyms does 3-chloro-2-fluoro-6-nitrophenol have? |
| A: English synonyms of 3-chloro-2-fluoro-6-nitrophenol: 2-fluoro-3-chloro-6-nitrophenol, Phenol,3-chloro-2-fluoro-6-nitro. |
| Q: What is the SMILES notation of 3-chloro-2-fluoro-6-nitrophenol? |
| A: SMILES notation of 3-chloro-2-fluoro-6-nitrophenol is O=[N+]([O-])c1ccc(Cl)c(F)c1O. |
| Q: What is the LogP of 3-chloro-2-fluoro-6-nitrophenol? |
| A: LogP of 3-chloro-2-fluoro-6-nitrophenol is 2.61610. |
| Q: What is the CAS number of 3-chloro-2-fluoro-6-nitrophenol? |
| A: CAS number of 3-chloro-2-fluoro-6-nitrophenol is 82419-40-7. |
| Q: What is the English name of 3-chloro-2-fluoro-6-nitrophenol? |
| A: The English name of 3-chloro-2-fluoro-6-nitrophenol is 3-chloro-2-fluoro-6-nitrophenol. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |