4-hydroxy-3-(3-methyl-2-oxobutyl)naphthalene-1,2-dione structure
|
Common Name | 4-hydroxy-3-(3-methyl-2-oxobutyl)naphthalene-1,2-dione | ||
|---|---|---|---|---|
| CAS Number | 82423-04-9 | Molecular Weight | 258.26900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-hydroxy-3-(3-methyl-2-oxobutyl)naphthalene-1,2-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H14O4 |
|---|---|
| Molecular Weight | 258.26900 |
| Exact Mass | 258.08900 |
| PSA | 71.44000 |
| LogP | 2.33630 |
| InChIKey | PPIAEUZVBXGDGR-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)CC1=C(O)c2ccccc2C(=O)C1=O |
|
~%
4-hydroxy-3-(3-... CAS#:82423-04-9 |
| Literature: Ettlinger Journal of the American Chemical Society, 1950 , vol. 72, p. 3666,3672 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-Hydroxy-3-(3-methyl-2-oxo-butyl)-[1,4]naphthochinon |
| 1,4-Naphthalenedione,2-hydroxy-3-(3-methyl-2-oxobutyl) |
| 2-hydroxy-3-(3-methyl-2-oxo-butyl)-[1,4]naphthoquinone |