20-O-Acetylingenol-3-angelate
20-O-Acetylingenol-3-angelate structure
|
Common Name | 20-O-Acetylingenol-3-angelate | ||
|---|---|---|---|---|
| CAS Number | 82425-35-2 | Molecular Weight | 472.57 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 603.2±55.0 °C at 760 mmHg | |
| Molecular Formula | C27H36O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 318.6±31.5 °C | |
Use of 20-O-Acetylingenol-3-angelate20-O-Acetylingenol-3-angelate is a natural compound. |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Betamethasone dipropionate |
|---|---|
| Synonym | More Synonyms |
This table contains bioactivity, target information and biological‑assay experimental data of this compound.
| Description | 20-O-Acetylingenol-3-angelate is a natural compound. |
|---|---|
| Related Catalog |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 603.2±55.0 °C at 760 mmHg |
| Molecular Formula | C27H36O7 |
| Molecular Weight | 472.57 |
| Flash Point | 318.6±31.5 °C |
| LogP | 4.42 |
| Vapour Pressure | 0.0±3.9 mmHg at 25°C |
| Index of Refraction | 1.550 |
| InChIKey | ZYCAGKYWXRKLSN-KNOVOCADSA-N |
| SMILES | CC=C(C)C(=O)OC1C(C)=CC23C(=O)C(C=C(COC(C)=O)C(O)C12O)C1C(CC3C)C1(C)C |
| Storage condition | 2-8℃ |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Diprolene |
| Diprosis |
| UNII-826Y60901U |
| (8S,9R,10S,11S,13S,14S,16S,17R)-9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-17-[(propanoyloxy)acetyl]-6,7,8,9,10,11,12,13,14,15,16,17-dodecahydro-3H-cyclopenta[a]phenanthren-17-yl propanoate |
| Diprosone |
| (11β,16β)-9-Fluoro-11-hydroxy-16-methyl-3,20-dioxopregna-1,4-diene-17,21-diyl dipropanoate |
| Rinderon-DP |
| SCH-11460 |
| betamethasone-17,21-dipropionate |
| (11b,16b)-9-Fluoro-11,17,21-trihydroxy-16-methylpregna-1,4-diene-3,20-dione 17,21-Dipropionate |
| Diproderm |
| Betamethasone dipropionate |
| Maxivate |
| Diprophos |
| 20-O-Acetylingenol-3-angelate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the storage conditions for Betamethasone dipropionate? |
| A: Storage conditions for Betamethasone dipropionate: 2-8℃. |
| Q: What is the molecular weight of Betamethasone dipropionate? |
| A: Molecular weight of Betamethasone dipropionate is 472.57. |
| Q: What is the LogP of Betamethasone dipropionate? |
| A: LogP of Betamethasone dipropionate is 4.42. |
| Q: What are the uses of Betamethasone dipropionate? |
| A: Main uses of Betamethasone dipropionate: 20-O-Acetylingenol-3-angelate is a natural compound. |
| Q: What is the SMILES notation of Betamethasone dipropionate? |
| A: SMILES notation of Betamethasone dipropionate is CC=C(C)C(=O)OC1C(C)=CC23C(=O)C(C=C(COC(C)=O)C(O)C12O)C1C(CC3C)C1(C)C. |
| Q: What is the InChIKey of Betamethasone dipropionate? |
| A: InChIKey of Betamethasone dipropionate is ZYCAGKYWXRKLSN-KNOVOCADSA-N. |
| Q: What is the CAS number of Betamethasone dipropionate? |
| A: CAS number of Betamethasone dipropionate is 82425-35-2. |
| Q: What is the molecular formula of Betamethasone dipropionate? |
| A: Molecular formula of Betamethasone dipropionate is C27H36O7. |
| Q: What is the boiling point of Betamethasone dipropionate? |
| A: Boiling point of Betamethasone dipropionate is 603.2±55.0 °C at 760 mmHg. |
| Q: What is the English name of Betamethasone dipropionate? |
| A: The English name of Betamethasone dipropionate is Betamethasone dipropionate. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |
| naturewill |